1-Hydroxy-10-methylacridone
| Internal ID | 17930c79-6b08-4969-bb9a-b92346d5f049 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 1-hydroxy-10-methylacridin-9-one |
| SMILES (Canonical) | CN1C2=C(C(=CC=C2)O)C(=O)C3=CC=CC=C31 |
| SMILES (Isomeric) | CN1C2=C(C(=CC=C2)O)C(=O)C3=CC=CC=C31 |
| InChI | InChI=1S/C14H11NO2/c1-15-10-6-3-2-5-9(10)14(17)13-11(15)7-4-8-12(13)16/h2-8,16H,1H3 |
| InChI Key | NHYDBJFGZCQFEO-UHFFFAOYSA-N |
| Popularity | 26 references in papers |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.078978594 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 3.80 |
| 1-hydroxy-10-methylacridone |
| 1-hydroxy-N-methylacridone |
| 1-hydroxy-10-methylacridin-9-one |
| 1-Hydroxy-10-methylacridin-9(10H)-one |
| 1-Hydroxy-10-methyl-9(10H)-acridinone |
| 1-HYDROXY-10-METHYL-10H-ACRIDIN-9-ONE |
| 1-HYDROXY-10-METHYL-9,10-DIHYDROACRIDIN-9-ONE |
| 9(10H)-Acridinone, 1-hydroxy-10-methyl- |
| 1-Hydrxy-N-methylacridon |
| MLS000755253 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL5514 | P42858 | Huntingtin |
15848.9 nM |
Potency |
via CMAUP
|
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
11220.2 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.37% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.93% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.84% | 93.99% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.65% | 91.49% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 91.21% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.51% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.13% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.24% | 94.75% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.03% | 93.65% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.67% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.12% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.89% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.17% | 85.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.31% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Boronia lanceolata |
| Ruta chalepensis |
| Ruta graveolens |
| Thamnosma rhodesica |
| PubChem | 5376484 |
| NPASS | NPC204867 |
| ChEMBL | CHEMBL1288799 |
| LOTUS | LTS0118813 |
| wikiData | Q82229468 |