1-Deoxynojirimycin
| Internal ID | ecbaa4f3-3faf-4615-97f3-f7da6df8fcf8 |
| Taxonomy | Organoheterocyclic compounds > Piperidines |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES (Canonical) | C1C(C(C(C(N1)CO)O)O)O |
| SMILES (Isomeric) | C1[C@@H]([C@H]([C@@H]([C@H](N1)CO)O)O)O |
| InChI | InChI=1S/C6H13NO4/c8-2-3-5(10)6(11)4(9)1-7-3/h3-11H,1-2H2/t3-,4+,5-,6-/m1/s1 |
| InChI Key | LXBIFEVIBLOUGU-JGWLITMVSA-N |
| Popularity | 1,675 references in papers |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08445790 g/mol |
| Topological Polar Surface Area (TPSA) | 93.00 Ų |
| XlogP | -2.30 |
| Atomic LogP (AlogP) | -2.97 |
| H-Bond Acceptor | 5 |
| H-Bond Donor | 5 |
| Rotatable Bonds | 1 |
| 19130-96-2 |
| DUVOGLUSTAT |
| Moranoline |
| deoxynojirimycin |
| (2R,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol |
| Moranolin |
| 1 Deoxynojirimycin |
| 1,5-Deoxy-1,5-imino-D-mannitol |
| D-1-deoxynojirimycin |
| 1,5-Dideoxy-1,5-imino-D-glucitol |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5860 | 58.60% |
| Caco-2 | - | 0.9638 | 96.38% |
| Blood Brain Barrier | - | 0.7000 | 70.00% |
| Human oral bioavailability | + | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.5069 | 50.69% |
| OATP2B1 inhibitior | - | 0.8513 | 85.13% |
| OATP1B1 inhibitior | + | 0.9687 | 96.87% |
| OATP1B3 inhibitior | + | 0.9464 | 94.64% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | - | 0.9703 | 97.03% |
| P-glycoprotein inhibitior | - | 0.9809 | 98.09% |
| P-glycoprotein substrate | - | 0.9003 | 90.03% |
| CYP3A4 substrate | - | 0.6978 | 69.78% |
| CYP2C9 substrate | - | 0.8129 | 81.29% |
| CYP2D6 substrate | + | 0.4032 | 40.32% |
| CYP3A4 inhibition | - | 0.9886 | 98.86% |
| CYP2C9 inhibition | - | 0.9543 | 95.43% |
| CYP2C19 inhibition | - | 0.9671 | 96.71% |
| CYP2D6 inhibition | - | 0.9230 | 92.30% |
| CYP1A2 inhibition | - | 0.9401 | 94.01% |
| CYP2C8 inhibition | - | 0.9700 | 97.00% |
| CYP inhibitory promiscuity | - | 0.9896 | 98.96% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.9400 | 94.00% |
| Carcinogenicity (trinary) | Non-required | 0.7115 | 71.15% |
| Eye corrosion | - | 0.9673 | 96.73% |
| Eye irritation | - | 0.9129 | 91.29% |
| Skin irritation | - | 0.7356 | 73.56% |
| Skin corrosion | - | 0.8573 | 85.73% |
| Ames mutagenesis | + | 0.5900 | 59.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5594 | 55.94% |
| Micronuclear | + | 0.5700 | 57.00% |
| Hepatotoxicity | - | 0.7410 | 74.10% |
| skin sensitisation | - | 0.8770 | 87.70% |
| Respiratory toxicity | - | 0.7333 | 73.33% |
| Reproductive toxicity | + | 0.6556 | 65.56% |
| Mitochondrial toxicity | + | 0.7750 | 77.50% |
| Nephrotoxicity | - | 0.6667 | 66.67% |
| Acute Oral Toxicity (c) | III | 0.8044 | 80.44% |
| Estrogen receptor binding | - | 0.8814 | 88.14% |
| Androgen receptor binding | - | 0.8849 | 88.49% |
| Thyroid receptor binding | - | 0.7648 | 76.48% |
| Glucocorticoid receptor binding | - | 0.7670 | 76.70% |
| Aromatase binding | - | 0.8263 | 82.63% |
| PPAR gamma | - | 0.8627 | 86.27% |
| Honey bee toxicity | - | 0.9278 | 92.78% |
| Biodegradation | + | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.8200 | 82.00% |
| Fish aquatic toxicity | - | 0.9926 | 99.26% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL2524 | P06280 | Alpha-galactosidase A |
18000 nM 13 nM |
Ki IC50 |
PMID: 14684301
via Super-PRED |
| CHEMBL4176 | P04066 | Alpha-L-fucosidase I |
26000 nM |
IC50 |
PMID: 7966130
|
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase |
240000 nM 195000 nM 118000 nM |
IC50 IC50 IC50 |
PMID: 18595718
PMID: 23106358 DOI: 10.1016/S0960-894X(01)80688-0 |
| CHEMBL5272 | P35573 | Glycogen debranching enzyme |
10000 nM |
IC50 |
PMID: 20000679
|
| CHEMBL2608 | P10253 | Lysosomal alpha-glucosidase |
82.3 nM 36.6 nM 1000 nM 1500 nM 1500 nM 60 nM |
Potency Potency IC50 IC50 IC50 IC50 |
via Super-PRED
via Super-PRED PMID: 18595718 PMID: 20000679 PMID: 19853441 PMID: 18595718 |
| CHEMBL2074 | O43451 | Maltase-glucoamylase |
40 nM 40 nM 360 nM |
IC50 IC50 IC50 |
PMID: 15771446
via Super-PRED PMID: 7608901 |
| CHEMBL2748 | P14410 | Sucrase-isomaltase |
2000 nM |
IC50 |
PMID: 20000679
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.10% | 97.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.70% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.39% | 96.09% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 90.52% | 94.55% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.89% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.83% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.03% | 94.45% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.32% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 29435 |
| NPASS | NPC306462 |
| ChEMBL | CHEMBL307429 |
| LOTUS | LTS0004153 |
| wikiData | Q15274561 |