1-(2-Hydroxy-4,6-dimethoxyphenyl)-3-phenylpropan-1-one
| Internal ID | 5d35b253-916f-4a49-830f-d43b1f2c2b52 |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxy-dihydrochalcones |
| IUPAC Name | 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylpropan-1-one |
| SMILES (Canonical) | COC1=CC(=C(C(=C1)OC)C(=O)CCC2=CC=CC=C2)O |
| SMILES (Isomeric) | COC1=CC(=C(C(=C1)OC)C(=O)CCC2=CC=CC=C2)O |
| InChI | InChI=1S/C17H18O4/c1-20-13-10-15(19)17(16(11-13)21-2)14(18)9-8-12-6-4-3-5-7-12/h3-7,10-11,19H,8-9H2,1-2H3 |
| InChI Key | JAJFQMZJIQDRSX-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 3.60 |
| 3791-76-2 |
| Dihydroflavokawin B |
| 1-(2-Hydroxy-4,6-dimethoxy-phenyl)-3-phenyl-propan-1-one |
| CHEMBL492166 |
| dihydroflavokawain b |
| NSC112157 |
| SCHEMBL1937964 |
| DTXSID10296851 |
| BDBM50491167 |
| LMPK12120513 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.66% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.26% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.19% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.15% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.97% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.91% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.45% | 90.20% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.43% | 90.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.87% | 95.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.54% | 98.75% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 88.01% | 92.67% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.13% | 99.15% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.44% | 94.73% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.93% | 85.14% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.00% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alpinia formosana |
| Alpinia zerumbet |
| Empetrum nigrum |
| Piper aduncum |
| Sarcandra glabra |
| PubChem | 270058 |
| LOTUS | LTS0273263 |
| wikiData | Q82037643 |