(1R,5R,6R,7R,13S,21R)-5,13-bis(3,4-dihydroxyphenyl)-7-[(2S,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-4,12,14-trioxapentacyclo[11.7.1.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaene-6,9,17,19,21-pentol
Internal ID | 17986442-4b7d-4761-aec9-65713bcf750f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | (1R,5R,6R,7R,13S,21R)-5,13-bis(3,4-dihydroxyphenyl)-7-[(2S,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-4,12,14-trioxapentacyclo[11.7.1.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaene-6,9,17,19,21-pentol |
SMILES (Canonical) | C1C(C(OC2=C1C(=CC(=C2C3C(C(OC4=C3C(=CC5=C4C6C(C(O5)(OC7=CC(=CC(=C67)O)O)C8=CC(=C(C=C8)O)O)O)O)C9=CC(=C(C=C9)O)O)O)O)O)C1=CC(=C(C=C1)O)O)O |
SMILES (Isomeric) | C1[C@@H]([C@@H](OC2=C1C(=CC(=C2[C@H]3[C@H]([C@H](OC4=C3C(=CC5=C4[C@@H]6[C@H]([C@](O5)(OC7=CC(=CC(=C67)O)O)C8=CC(=C(C=C8)O)O)O)O)C9=CC(=C(C=C9)O)O)O)O)O)C1=CC(=C(C=C1)O)O)O |
InChI | InChI=1S/C45H36O18/c46-18-10-27(54)33-31(11-18)62-45(17-3-6-22(49)26(53)9-17)44(59)38(33)36-32(63-45)14-29(56)35-37(39(58)41(61-43(35)36)16-2-5-21(48)25(52)8-16)34-28(55)13-23(50)19-12-30(57)40(60-42(19)34)15-1-4-20(47)24(51)7-15/h1-11,13-14,30,37-41,44,46-59H,12H2/t30-,37+,38+,39+,40-,41+,44+,45-/m0/s1 |
InChI Key | BYSRPHRKESMCPO-XFQYXILPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H36O18 |
Molecular Weight | 864.80 g/mol |
Exact Mass | 864.19016430 g/mol |
Topological Polar Surface Area (TPSA) | 320.00 Ų |
XlogP | 3.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.70% | 91.11% |
CHEMBL233 | P35372 | Mu opioid receptor | 95.55% | 97.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.31% | 96.09% |
CHEMBL236 | P41143 | Delta opioid receptor | 93.92% | 99.35% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.98% | 91.49% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.96% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.11% | 89.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 88.23% | 96.12% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.71% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 86.71% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.04% | 99.15% |
CHEMBL2535 | P11166 | Glucose transporter | 85.61% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.83% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.69% | 95.56% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.60% | 94.62% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.45% | 85.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aesculus hippocastanum |
Pavetta owariensis |
PubChem | 13990887 |
LOTUS | LTS0148489 |
wikiData | Q104949878 |