methyl (1S,4aS,6S,7R,7aS)-6,7-dihydroxy-7-methyl-1-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate
Internal ID | a1489e49-db75-468f-85b4-f58c7c6e4daf |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl (1S,4aS,6S,7R,7aS)-6,7-dihydroxy-7-methyl-1-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1(C(CC2C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@@]1([C@H](C[C@H]2[C@@H]1[C@@H](OC=C2C(=O)OC)O[C@@H]3[C@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O |
InChI | InChI=1S/C17H26O11/c1-17(24)9(19)3-6-7(14(23)25-2)5-26-15(10(6)17)28-16-13(22)12(21)11(20)8(4-18)27-16/h5-6,8-13,15-16,18-22,24H,3-4H2,1-2H3/t6-,8-,9+,10-,11-,12+,13+,15+,16-,17+/m1/s1 |
InChI Key | VIXATJMNFXMPDC-BAEKIKMYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H26O11 |
Molecular Weight | 406.40 g/mol |
Exact Mass | 406.14751164 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | -2.60 |
There are no found synonyms. |
![2D Structure of methyl (1S,4aS,6S,7R,7aS)-6,7-dihydroxy-7-methyl-1-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate 2D Structure of methyl (1S,4aS,6S,7R,7aS)-6,7-dihydroxy-7-methyl-1-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/07db88d0-8459-11ee-8be7-8d79cf727048.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.87% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.13% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.57% | 83.82% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.54% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.31% | 96.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.40% | 85.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.01% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.09% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.18% | 86.92% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.94% | 91.24% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.00% | 95.83% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.11% | 94.45% |
CHEMBL5028 | O14672 | ADAM10 | 81.91% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.71% | 89.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.64% | 90.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.26% | 92.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.96% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.95% | 99.17% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.52% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lamium purpureum |
Lippia alba |
Lippia origanoides |
Plantago sempervirens |
PubChem | 154496318 |
LOTUS | LTS0218226 |
wikiData | Q105287072 |