(-)-Sparteine
Internal ID | f17f001c-e89f-4fb6-b76a-6ede8a304723 |
Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Sparteine, lupanine, and related alkaloids |
IUPAC Name | 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane |
SMILES (Canonical) | C1CCN2CC3CC(C2C1)CN4C3CCCC4 |
SMILES (Isomeric) | C1CCN2CC3CC(C2C1)CN4C3CCCC4 |
InChI | InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2 |
InChI Key | SLRCCWJSBJZJBV-UHFFFAOYSA-N |
Popularity | 926 references in papers |
Molecular Formula | C15H26N2 |
Molecular Weight | 234.38 g/mol |
Exact Mass | 234.209598838 g/mol |
Topological Polar Surface Area (TPSA) | 6.50 Ų |
XlogP | 2.50 |
90-39-1 |
.beta.-Isosparteine |
(?)-Lupinidine |
Sparteine non-stereo |
SCHEMBL8913122 |
CHEMBL2010478 |
DTXSID00859156 |
SLRCCWJSBJZJBV-UHFFFAOYSA-N |
7,14-Methano-2H,6H-dipyrido[1,2-a:1',2'-e][1,5]diazocine, dodecahydro-, [7S-(7.alpha.,7a.alpha.,14.alpha.,14a.alpha.)]- |
7,14-Methano-2H,6H-dipyrido[1,2-a:1',2'-e][1,5]diazocine, dodecahydro-, [7S-(7.alpha.,7a.alpha.,14.alpha.,14a.beta.)]- |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293235 | P02545 | Prelamin-A/C |
316.2 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.88% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.02% | 97.09% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 88.35% | 94.78% |
CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 87.98% | 97.98% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 87.38% | 91.76% |
CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 86.53% | 95.61% |
CHEMBL238 | Q01959 | Dopamine transporter | 85.86% | 95.88% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.48% | 95.50% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.92% | 93.04% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 83.38% | 98.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.87% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.58% | 96.09% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 81.53% | 91.43% |
CHEMBL237 | P41145 | Kappa opioid receptor | 81.53% | 98.10% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.62% | 86.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.42% | 89.62% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.22% | 99.18% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 80.21% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 3966 |
LOTUS | LTS0152016 |
wikiData | Q105255566 |