(-)-Rosmadial
Internal ID | bab66efa-cea6-4dd0-98f9-45080c0cb70b |
Taxonomy | Organoheterocyclic compounds > Benzofurans |
IUPAC Name | 7-hydroxy-2',2'-dimethyl-2-oxo-6-propan-2-ylspiro[1-benzofuran-3,6'-cyclohexane]-1',4-dicarbaldehyde |
SMILES (Canonical) | CC(C)C1=C(C2=C(C(=C1)C=O)C3(CCCC(C3C=O)(C)C)C(=O)O2)O |
SMILES (Isomeric) | CC(C)C1=C(C2=C(C(=C1)C=O)C3(CCCC(C3C=O)(C)C)C(=O)O2)O |
InChI | InChI=1S/C20H24O5/c1-11(2)13-8-12(9-21)15-17(16(13)23)25-18(24)20(15)7-5-6-19(3,4)14(20)10-22/h8-11,14,23H,5-7H2,1-4H3 |
InChI Key | JBWRHBJFAVSAMJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H24O5 |
Molecular Weight | 344.40 g/mol |
Exact Mass | 344.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 80.70 Ų |
XlogP | 3.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.08% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.02% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.29% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 95.19% | 98.95% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.30% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.60% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.49% | 97.25% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 90.88% | 98.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.86% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.54% | 86.33% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.13% | 93.40% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.07% | 96.77% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.88% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.96% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.74% | 93.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.87% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.22% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.68% | 99.15% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.56% | 96.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.95% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Myristica fragrans |
Rosmarinus officinalis |
Salvia africana-lutea |
Salvia columbariae |
Salvia mellifera |
Salvia officinalis |
Salvia przewalskii |
PubChem | 72996596 |
LOTUS | LTS0255026 |
wikiData | Q105124617 |