(-)-Oleoside 11-methyl ester
Internal ID | 079028cf-7328-43ee-bc83-8f69110cf676 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | 2-[(3Z)-3-ethylidene-5-methoxycarbonyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetic acid |
SMILES (Canonical) | CC=C1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)O |
SMILES (Isomeric) | C/C=C\1/C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)O |
InChI | InChI=1S/C17H24O11/c1-3-7-8(4-11(19)20)9(15(24)25-2)6-26-16(7)28-17-14(23)13(22)12(21)10(5-18)27-17/h3,6,8,10,12-14,16-18,21-23H,4-5H2,1-2H3,(H,19,20)/b7-3- |
InChI Key | XSCVKBFEPYGZSL-CLTKARDFSA-N |
Popularity | 4 references in papers |
Molecular Formula | C17H24O11 |
Molecular Weight | 404.40 g/mol |
Exact Mass | 404.13186158 g/mol |
Topological Polar Surface Area (TPSA) | 172.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.71% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.95% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 91.40% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.11% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.18% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.19% | 96.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.16% | 86.92% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.97% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.60% | 85.14% |
CHEMBL5028 | O14672 | ADAM10 | 81.23% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Fraxinus americana |
Fraxinus excelsior |
Jasminum nudiflorum |
Jasminum polyanthum |
Jasminum sambac |
Olea europaea |
Picconia excelsa |
Syringa vulgaris |
PubChem | 131753164 |
LOTUS | LTS0173637 |
wikiData | Q104389718 |