(+)-Epiexcelsin
Internal ID | b1decd3d-aabf-4a02-92a0-fcfb228cf059 |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans |
IUPAC Name | 6-[(3S,3aR,6R,6aR)-3-(7-methoxy-1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-4-methoxy-1,3-benzodioxole |
SMILES (Canonical) | COC1=CC(=CC2=C1OCO2)C3C4COC(C4CO3)C5=CC6=C(C(=C5)OC)OCO6 |
SMILES (Isomeric) | COC1=CC(=CC2=C1OCO2)[C@H]3[C@H]4CO[C@@H]([C@H]4CO3)C5=CC6=C(C(=C5)OC)OCO6 |
InChI | InChI=1S/C22H22O8/c1-23-15-3-11(5-17-21(15)29-9-27-17)19-13-7-26-20(14(13)8-25-19)12-4-16(24-2)22-18(6-12)28-10-30-22/h3-6,13-14,19-20H,7-10H2,1-2H3/t13-,14-,19-,20+/m0/s1 |
InChI Key | KDZZYNRHNQOKQW-WZBLMQSHSA-N |
Popularity | 2 references in papers |
Molecular Formula | C22H22O8 |
Molecular Weight | 414.40 g/mol |
Exact Mass | 414.13146766 g/mol |
Topological Polar Surface Area (TPSA) | 73.80 Ų |
XlogP | 2.60 |
51020-09-8 |
6-((2S,6R)-6-(7-Methoxy(2H-benzo(3,4-d)1,3-dioxolen-5-yl))-3,7-dioxabicyclo(3.3.0)oct-2-yl)-4-methoxy-2H-benzo(d)1,3-dioxolene |
6-[(2S,6R)-6-(7-Methoxy(2H-benzo[3,4-d]1,3-dioxolen-5-yl))-3,7-dioxabicyclo[3.3.0]oct-2-yl]-4-methoxy-2H-benzo[d]1,3-dioxolene |
6-[(3S,3aR,6R,6aR)-3-(7-methoxy-1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-4-methoxy-1,3-benzodioxole |
DTXSID20199021 |
![2D Structure of (+)-Epiexcelsin 2D Structure of (+)-Epiexcelsin](https://plantaedb.com/storage/docs/compounds/2023/11/-epiexcelsin.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.61% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.56% | 96.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.25% | 92.62% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.05% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.41% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.65% | 97.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.07% | 97.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.60% | 86.33% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 84.88% | 82.67% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.30% | 92.94% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.13% | 89.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.19% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.91% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.49% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Litsea verticillata |
Piper arborescens |
PubChem | 489948 |
LOTUS | LTS0221882 |
wikiData | Q83071904 |