ZT72DJ66LU
Internal ID | b3ecc365-66ad-4400-bfbf-6ca8b8095e1f |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | (1S,4S,7R,9R,10R,14R)-7-(furan-3-yl)-9-methyl-6,16-dioxatetracyclo[8.7.0.01,14.04,9]heptadec-12-ene-5,15-dione |
SMILES (Canonical) | CC12CC(OC(=O)C1CCC34C2CC=CC3C(=O)OC4)C5=COC=C5 |
SMILES (Isomeric) | C[C@]12C[C@@H](OC(=O)[C@H]1CC[C@]34[C@@H]2CC=C[C@H]3C(=O)OC4)C5=COC=C5 |
InChI | InChI=1S/C20H22O5/c1-19-9-15(12-6-8-23-10-12)25-18(22)13(19)5-7-20-11-24-17(21)14(20)3-2-4-16(19)20/h2-3,6,8,10,13-16H,4-5,7,9,11H2,1H3/t13-,14+,15-,16-,19+,20-/m1/s1 |
InChI Key | OVZMEMYVSDTLOA-XNCJAFBWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H22O5 |
Molecular Weight | 342.40 g/mol |
Exact Mass | 342.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 65.70 Ų |
XlogP | 2.80 |
ZT72DJ66LU |
67927-55-3 |
NSC-310634 |
AKOS040753910 |
(3R,4AR,4BR,7AR,10AS,12AS)-3-(3-FURANYL)-3,4,4A,5,7A,11,12,12A-OCTAHYDRO-4A-METHYL-1H,10H-FURO(3',4':4A,5)NAPHTHO(2,1-C)PYRAN-1,8(4BH)-DIONE |
1H,10H-FURO(3',4':4A,5)NAPHTHO(2,1-C)PYRAN-1,8(4BH)-DIONE, 3-(3-FURANYL)-3,4,4A,5,7A,11,12,12A-OCTAHYDRO-4A-METHYL-, (3R,4AR,4BR,7AR,10AS,12AS)- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.75% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.56% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.27% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.25% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.28% | 82.69% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.11% | 95.56% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.55% | 96.38% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.17% | 97.25% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.97% | 94.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.43% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.78% | 99.23% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 83.75% | 91.38% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.34% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.00% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.52% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salvia rhyacophila |
Salvia splendens |
PubChem | 15705466 |
LOTUS | LTS0197392 |
wikiData | Q105201747 |