yuccaol D
Internal ID | 31acda9b-4799-44b8-9181-818d576b0052 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | (2'R,3S)-4-[(E)-2-(3,5-dihydroxy-4-methoxyphenyl)ethenyl]-4',6,6'-trihydroxy-2'-(4-hydroxyphenyl)spiro[1-benzofuran-3,3'-2H-1-benzofuran]-2-one |
SMILES (Canonical) | COC1=C(C=C(C=C1O)C=CC2=C3C(=CC(=C2)O)OC(=O)C34C(OC5=CC(=CC(=C45)O)O)C6=CC=C(C=C6)O)O |
SMILES (Isomeric) | COC1=C(C=C(C=C1O)/C=C/C2=C3C(=CC(=C2)O)OC(=O)[C@@]34[C@H](OC5=CC(=CC(=C45)O)O)C6=CC=C(C=C6)O)O |
InChI | InChI=1S/C30H22O10/c1-38-27-21(35)8-14(9-22(27)36)2-3-16-10-18(32)12-23-25(16)30(29(37)40-23)26-20(34)11-19(33)13-24(26)39-28(30)15-4-6-17(31)7-5-15/h2-13,28,31-36H,1H3/b3-2+/t28-,30+/m1/s1 |
InChI Key | UMQRRGZFEXVPFD-ZJVMSYRRSA-N |
Popularity | 2 references in papers |
Molecular Formula | C30H22O10 |
Molecular Weight | 542.50 g/mol |
Exact Mass | 542.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 4.20 |
CHEMBL479344 |
(2'R,3S)-4-[(E)-2-(3,5-Dihydroxy-4-methoxyphenyl)ethenyl]-4',6,6'-trihydroxy-2'-(4-hydroxyphenyl)spiro[1-benzofuran-3,3'-2H-1-benzofuran]-2-one |
![2D Structure of yuccaol D 2D Structure of yuccaol D](https://plantaedb.com/storage/docs/compounds/2023/11/yuccaol-d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.96% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.56% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.03% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 94.54% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.12% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.49% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.27% | 99.23% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.21% | 93.40% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.29% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.68% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 88.23% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.49% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.85% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.64% | 99.15% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.35% | 93.99% |
CHEMBL2535 | P11166 | Glucose transporter | 81.18% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Yucca schidigera |
PubChem | 10076008 |
LOTUS | LTS0242440 |
wikiData | Q105275664 |