Yuccaol A
Internal ID | 18ab9844-7c0d-4b34-b934-849a56d6171b |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | (2'R,3S)-4',6,6'-trihydroxy-2'-(4-hydroxyphenyl)-4-[(E)-2-(4-hydroxyphenyl)ethenyl]spiro[1-benzofuran-3,3'-2H-1-benzofuran]-2-one |
SMILES (Canonical) | C1=CC(=CC=C1C=CC2=C3C(=CC(=C2)O)OC(=O)C34C(OC5=CC(=CC(=C45)O)O)C6=CC=C(C=C6)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C/C2=C3C(=CC(=C2)O)OC(=O)[C@@]34[C@H](OC5=CC(=CC(=C45)O)O)C6=CC=C(C=C6)O)O |
InChI | InChI=1S/C29H20O8/c30-18-7-2-15(3-8-18)1-4-17-11-20(32)13-23-25(17)29(28(35)37-23)26-22(34)12-21(33)14-24(26)36-27(29)16-5-9-19(31)10-6-16/h1-14,27,30-34H/b4-1+/t27-,29+/m1/s1 |
InChI Key | YOJXOIWMUVWNAB-JKFOSBIYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C29H20O8 |
Molecular Weight | 496.50 g/mol |
Exact Mass | 496.11581759 g/mol |
Topological Polar Surface Area (TPSA) | 137.00 Ų |
XlogP | 4.60 |
CHEMBL470662 |
![2D Structure of Yuccaol A 2D Structure of Yuccaol A](https://plantaedb.com/storage/docs/compounds/2023/11/yuccaol-a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.86% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 96.77% | 90.71% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.87% | 93.40% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.64% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.62% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.57% | 89.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.03% | 93.99% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.75% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.40% | 99.23% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 87.71% | 85.11% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.34% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.98% | 97.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.86% | 91.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.24% | 96.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 83.65% | 96.12% |
CHEMBL2581 | P07339 | Cathepsin D | 83.28% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.76% | 94.73% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 82.55% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Yucca schidigera |
PubChem | 10255261 |
LOTUS | LTS0254407 |
wikiData | Q105351358 |