Yayoisaponin C
Internal ID | 7cbe0f40-90d4-46b7-b413-7c5af2c9abb5 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[2-[6-(15,19-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC(C6C5(CC(C(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)OC9C(C(C(C(O9)CO)O)O)O)OC2C(C(C(C(O2)CO)O)O)O)O)O)O)C)O)C)C)OC1 |
SMILES (Isomeric) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC(C6C5(CC(C(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)OC9C(C(C(C(O9)CO)O)O)O)OC2C(C(C(C(O2)CO)O)O)O)O)O)O)C)O)C)C)OC1 |
InChI | InChI=1S/C51H84O25/c1-18-5-8-51(67-17-18)19(2)32-27(76-51)10-22-20-9-24(56)23-11-26(25(57)12-50(23,4)21(20)6-7-49(22,32)3)68-45-41(66)38(63)42(31(16-55)72-45)73-48-44(75-47-40(65)37(62)34(59)29(14-53)70-47)43(35(60)30(15-54)71-48)74-46-39(64)36(61)33(58)28(13-52)69-46/h18-48,52-66H,5-17H2,1-4H3 |
InChI Key | IFCJNJJMBPXNRD-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C51H84O25 |
Molecular Weight | 1097.20 g/mol |
Exact Mass | 1096.53016816 g/mol |
Topological Polar Surface Area (TPSA) | 396.00 Ų |
XlogP | -2.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.98% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 97.30% | 96.61% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.03% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.00% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.38% | 95.93% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 93.97% | 96.21% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 92.91% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.20% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 91.80% | 98.10% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.71% | 92.86% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.56% | 92.50% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 88.13% | 97.86% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.79% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.53% | 95.89% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.42% | 95.58% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 86.34% | 95.38% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.18% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.87% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.15% | 95.89% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 83.68% | 89.05% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.64% | 96.77% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.23% | 86.92% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 82.70% | 97.31% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 82.31% | 96.67% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.09% | 97.28% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 81.85% | 99.17% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 81.77% | 97.64% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.71% | 91.24% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.68% | 89.00% |
CHEMBL233 | P35372 | Mu opioid receptor | 81.33% | 97.93% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.12% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium ampeloprasum |
Allium rotundum |
PubChem | 85125467 |
LOTUS | LTS0129228 |
wikiData | Q105112085 |