Xanthen-9-one, 5,8-dihydroxy-1-(beta-D-glucopyranosyloxy)-3-methoxy-
Internal ID | 90018686-5e87-420a-8fd2-9f02c6603015 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | 5,8-dihydroxy-3-methoxy-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
SMILES (Canonical) | COC1=CC2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=O)C4=C(C=CC(=C4O2)O)O |
SMILES (Isomeric) | COC1=CC2=C(C(=C1)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C(=O)C4=C(C=CC(=C4O2)O)O |
InChI | InChI=1S/C20H20O11/c1-28-7-4-10-14(16(25)13-8(22)2-3-9(23)19(13)29-10)11(5-7)30-20-18(27)17(26)15(24)12(6-21)31-20/h2-5,12,15,17-18,20-24,26-27H,6H2,1H3/t12-,15-,17+,18-,20-/m1/s1 |
InChI Key | CYNUMZCJGCZYTD-DIKOWXHZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H20O11 |
Molecular Weight | 436.40 g/mol |
Exact Mass | 436.10056145 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 0.60 |
CCRIS 5474 |
Xanthen-9-one, 5,8-dihydroxy-1-(beta-D-glucopyranosyloxy)-3-methoxy- |
9H-Xanthen-9-one, 8-(beta-D-glucopyranosyloxy)-1,5-dihydroxy-3-methoxy- |
SCHEMBL21060607 |
5,8-dihydroxy-3-methoxy-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
Q-100297 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.44% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.80% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.91% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.90% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.60% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 90.52% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.11% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.77% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.80% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.29% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.80% | 94.45% |
CHEMBL3194 | P02766 | Transthyretin | 85.72% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.22% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.83% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.37% | 86.92% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.87% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.39% | 96.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.58% | 96.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.19% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Swertia japonica |
PubChem | 5487923 |
LOTUS | LTS0193253 |
wikiData | Q76309628 |