Wubangziside B
Internal ID | 69dfda14-9ebc-4838-9587-2993dbf36ba6 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | 1-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
SMILES (Canonical) | C1=CC(=C2C(=C1)OC3=C(C2=O)C=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C2C(=C1)OC3=C(C2=O)C=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
InChI | InChI=1S/C19H18O9/c20-7-13-16(23)17(24)18(25)19(28-13)26-8-4-5-11-9(6-8)15(22)14-10(21)2-1-3-12(14)27-11/h1-6,13,16-21,23-25H,7H2/t13-,16-,17+,18-,19-/m1/s1 |
InChI Key | XPJKXAFFVPUMHO-LQDZTQBFSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H18O9 |
Molecular Weight | 390.30 g/mol |
Exact Mass | 390.09508215 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | 1.00 |
96935-32-9 |
1-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
Euxanthone-7-O-glucopyranoside |
DTXSID00242645 |
9H-Xanthen-9-one, 7-(beta-D-glucopyranosyloxy)-1-hydroxy- |
![2D Structure of Wubangziside B 2D Structure of Wubangziside B](https://plantaedb.com/storage/docs/compounds/2023/11/wubangziside-b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.22% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.55% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 95.41% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.05% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.90% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.75% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.21% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.61% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.18% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.06% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.57% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.24% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.86% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.68% | 86.33% |
CHEMBL220 | P22303 | Acetylcholinesterase | 84.19% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.67% | 86.92% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.11% | 92.94% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 80.17% | 88.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Polygala caudata |
Polygala wattersii |
PubChem | 5486995 |
LOTUS | LTS0190133 |
wikiData | Q83126448 |