Wasalexin A
Internal ID | 54dc640e-5be7-4189-b99c-6f39819edcee |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives |
IUPAC Name | (3E)-3-[[bis(methylsulfanyl)methylideneamino]methylidene]-1-methoxyindol-2-one |
SMILES (Canonical) | CON1C2=CC=CC=C2C(=CN=C(SC)SC)C1=O |
SMILES (Isomeric) | CON1C2=CC=CC=C2/C(=C\N=C(SC)SC)/C1=O |
InChI | InChI=1S/C13H14N2O2S2/c1-17-15-11-7-5-4-6-9(11)10(12(15)16)8-14-13(18-2)19-3/h4-8H,1-3H3/b10-8+ |
InChI Key | JJQPWCPYNJNWID-CSKARUKUSA-N |
Popularity | 7 references in papers |
Molecular Formula | C13H14N2O2S2 |
Molecular Weight | 294.40 g/mol |
Exact Mass | 294.04967004 g/mol |
Topological Polar Surface Area (TPSA) | 92.50 Ų |
XlogP | 2.80 |
CHEMBL103746 |
CHEBI:174780 |
(3E)-3-[[bis(methylsulanyl)methylideneamino]methylidene]-1-methoxyindol-2-one |
(3E)-3-({[bis(methylsulfanyl)methylidene]amino}methylidene)-1-methoxy-2,3-dihydro-1H-indol-2-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.79% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.56% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.40% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.33% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.80% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.27% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 83.25% | 98.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.96% | 99.23% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.49% | 96.67% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.36% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eutrema halophilum |
Eutrema japonicum |
Thlaspi arvense |
PubChem | 44333108 |
LOTUS | LTS0184843 |
wikiData | Q105129827 |