Vincristine (free base)
Internal ID | 96c7a1ab-cb6e-4967-a769-078bdf980fc5 |
Taxonomy | Alkaloids and derivatives > Vinca alkaloids |
IUPAC Name | methyl 11-acetyloxy-12-ethyl-4-(17-ethyl-17-hydroxy-13-methoxycarbonyl-1,11-diazatetracyclo[13.3.1.04,12.05,10]nonadeca-4(12),5,7,9-tetraen-13-yl)-8-formyl-10-hydroxy-5-methoxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-10-carboxylate |
SMILES (Canonical) | CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C=O)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O |
SMILES (Isomeric) | CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C=O)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O |
InChI | InChI=1S/C46H56N4O10/c1-7-42(55)22-28-23-45(40(53)58-5,36-30(14-18-48(24-28)25-42)29-12-9-10-13-33(29)47-36)32-20-31-34(21-35(32)57-4)50(26-51)38-44(31)16-19-49-17-11-15-43(8-2,37(44)49)39(60-27(3)52)46(38,56)41(54)59-6/h9-13,15,20-21,26,28,37-39,47,55-56H,7-8,14,16-19,22-25H2,1-6H3 |
InChI Key | OGWKCGZFUXNPDA-UHFFFAOYSA-N |
Popularity | 24,481 references in papers |
Molecular Formula | C46H56N4O10 |
Molecular Weight | 825.00 g/mol |
Exact Mass | 824.39964400 g/mol |
Topological Polar Surface Area (TPSA) | 171.00 Ų |
XlogP | 2.80 |
Vincristine (free base) |
Leurocristine |
57-22-7 |
Vincaleukoblastine, 22-oxo- |
CHEMBL1740907 |
OGWKCGZFUXNPDA-UHFFFAOYSA-N |
NCGC00163700-03 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2903 | P16050 | Arachidonate 15-lipoxygenase |
316.2 nM |
Potency |
via Super-PRED
|
CHEMBL5514 | P42858 | Huntingtin |
17.8 nM |
Potency |
via Super-PRED
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
1.1 nM |
Potency |
via Super-PRED
|
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR |
926.8 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.76% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.50% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.40% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.17% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.06% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 95.38% | 98.75% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 95.18% | 92.98% |
CHEMBL5747 | Q92793 | CREB-binding protein | 93.58% | 95.12% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 92.85% | 95.00% |
CHEMBL205 | P00918 | Carbonic anhydrase II | 90.86% | 98.44% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.77% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.44% | 89.00% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 89.62% | 91.79% |
CHEMBL5028 | O14672 | ADAM10 | 89.59% | 97.50% |
CHEMBL2581 | P07339 | Cathepsin D | 89.55% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.97% | 97.14% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 87.90% | 95.69% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 87.88% | 87.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.11% | 97.09% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.69% | 89.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.29% | 92.62% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 85.19% | 97.50% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.00% | 94.08% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 82.39% | 95.62% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 81.65% | 90.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.64% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.75% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.66% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Catharanthus roseus |
PubChem | 3717450 |
LOTUS | LTS0112704 |
wikiData | Q105191905 |