Vinblastine
Internal ID | 11bc7e0e-e71a-4a4e-b40d-eedd40400665 |
Taxonomy | Alkaloids and derivatives > Vinca alkaloids |
IUPAC Name | methyl (1R,9R,10S,11R,12R,19R)-11-acetyloxy-12-ethyl-4-[(13S,15R,17S)-17-ethyl-17-hydroxy-13-methoxycarbonyl-1,11-diazatetracyclo[13.3.1.04,12.05,10]nonadeca-4(12),5,7,9-tetraen-13-yl]-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-10-carboxylate |
SMILES (Canonical) | CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O |
SMILES (Isomeric) | CC[C@@]1(C[C@H]2C[C@@](C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)[C@]78CCN9[C@H]7[C@@](C=CC9)([C@H]([C@@]([C@@H]8N6C)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O |
InChI | InChI=1S/C46H58N4O9/c1-8-42(54)23-28-24-45(40(52)57-6,36-30(15-19-49(25-28)26-42)29-13-10-11-14-33(29)47-36)32-21-31-34(22-35(32)56-5)48(4)38-44(31)17-20-50-18-12-16-43(9-2,37(44)50)39(59-27(3)51)46(38,55)41(53)58-7/h10-14,16,21-22,28,37-39,47,54-55H,8-9,15,17-20,23-26H2,1-7H3/t28-,37-,38+,39+,42-,43+,44+,45-,46-/m0/s1 |
InChI Key | JXLYSJRDGCGARV-CFWMRBGOSA-N |
Popularity | 27,139 references in papers |
Molecular Formula | C46H58N4O9 |
Molecular Weight | 811.00 g/mol |
Exact Mass | 810.42037944 g/mol |
Topological Polar Surface Area (TPSA) | 154.00 Ų |
XlogP | 3.70 |
Atomic LogP (AlogP) | 3.99 |
H-Bond Acceptor | 12 |
H-Bond Donor | 3 |
Rotatable Bonds | 7 |
Vinblastin |
Vincaleucoblastin |
865-21-4 |
Vincaleucoblastine |
Vincaleukoblastine |
Vinblastina |
Vincoblastine |
Rozevin |
Nincaluicolflastine |
Vinblastinum |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9418 | 94.18% |
Caco-2 | - | 0.6792 | 67.92% |
Blood Brain Barrier | - | 0.6250 | 62.50% |
Human oral bioavailability | - | 0.9000 | 90.00% |
Subcellular localzation | Mitochondria | 0.6612 | 66.12% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8450 | 84.50% |
OATP1B3 inhibitior | + | 0.8977 | 89.77% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.8500 | 85.00% |
BSEP inhibitior | + | 1.0000 | 100.00% |
P-glycoprotein inhibitior | + | 0.8200 | 82.00% |
P-glycoprotein substrate | + | 0.9455 | 94.55% |
CYP3A4 substrate | + | 0.7980 | 79.80% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7622 | 76.22% |
CYP3A4 inhibition | - | 0.8149 | 81.49% |
CYP2C9 inhibition | - | 0.9093 | 90.93% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | - | 0.9231 | 92.31% |
CYP1A2 inhibition | - | 0.9198 | 91.98% |
CYP2C8 inhibition | - | 0.7423 | 74.23% |
CYP inhibitory promiscuity | - | 0.8681 | 86.81% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.9700 | 97.00% |
Carcinogenicity (trinary) | Non-required | 0.5437 | 54.37% |
Eye corrosion | - | 0.9897 | 98.97% |
Eye irritation | - | 0.9388 | 93.88% |
Skin irritation | - | 0.7957 | 79.57% |
Skin corrosion | - | 0.9433 | 94.33% |
Ames mutagenesis | - | 0.9600 | 96.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6890 | 68.90% |
Micronuclear | + | 0.7500 | 75.00% |
Hepatotoxicity | - | 0.7500 | 75.00% |
skin sensitisation | - | 0.8832 | 88.32% |
Respiratory toxicity | + | 0.9556 | 95.56% |
Reproductive toxicity | + | 0.9889 | 98.89% |
Mitochondrial toxicity | + | 0.9750 | 97.50% |
Nephrotoxicity | - | 0.6151 | 61.51% |
Acute Oral Toxicity (c) | III | 0.6578 | 65.78% |
Estrogen receptor binding | + | 0.8825 | 88.25% |
Androgen receptor binding | + | 0.8697 | 86.97% |
Thyroid receptor binding | + | 0.8462 | 84.62% |
Glucocorticoid receptor binding | + | 0.8971 | 89.71% |
Aromatase binding | - | 0.5908 | 59.08% |
PPAR gamma | + | 0.8708 | 87.08% |
Honey bee toxicity | - | 0.7281 | 72.81% |
Biodegradation | - | 0.9750 | 97.50% |
Crustacea aquatic toxicity | + | 0.5553 | 55.53% |
Fish aquatic toxicity | + | 0.9584 | 95.84% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
26000 nM |
IC50 |
PMID: 18980381
|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha |
316.2 nM |
Potency |
via Super-PRED
|
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 |
30000 nM |
IC50 |
PMID: 17132069
|
CHEMBL4302 | P08183 | P-glycoprotein 1 |
29000 nM 2000 nM 10471.29 nM 19900 nM 34000 nM 17700 nM 10000 nM 29500 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 |
PMID: 11374943
PMID: 19555122 PMID: 20483615 PMID: 23316950 PMID: 24063582 PMID: 25129171 PMID: 25856683 via CMAUP |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR |
20.7 nM |
Potency |
via Super-PRED
|
CHEMBL1697668 | Q9Y6L6 | Solute carrier organic anion transporter family member 1B1 |
46800 nM |
IC50 |
via CMAUP
|
CHEMBL1743121 | Q9NPD5 | Solute carrier organic anion transporter family member 1B3 |
43500 nM |
IC50 |
via CMAUP
|
CHEMBL1293256 | P40225 | Thrombopoietin |
398.1 nM |
Potency |
via Super-PRED
|
CHEMBL1835 | P24557 | Thromboxane-A synthase |
1870 nM |
IC50 |
via CMAUP
|
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
39.8 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.83% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.21% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.81% | 91.11% |
CHEMBL5747 | Q92793 | CREB-binding protein | 95.94% | 95.12% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.71% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 95.24% | 98.75% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 94.97% | 95.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.29% | 86.33% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 92.24% | 92.98% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 91.87% | 95.62% |
CHEMBL2581 | P07339 | Cathepsin D | 90.91% | 98.95% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.51% | 91.79% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.01% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.26% | 94.00% |
CHEMBL5028 | O14672 | ADAM10 | 87.92% | 97.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.44% | 97.09% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 86.73% | 97.50% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 86.15% | 90.95% |
CHEMBL205 | P00918 | Carbonic anhydrase II | 85.75% | 98.44% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.71% | 92.62% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.67% | 89.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.55% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.47% | 97.14% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.39% | 82.69% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.17% | 97.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.10% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Catharanthus roseus |
PubChem | 13342 |
NPASS | NPC195788 |
ChEMBL | CHEMBL159 |
LOTUS | LTS0102356 |
wikiData | Q105136630 |