Vernomycin B
Internal ID | a4be13a5-d5e4-4839-99c3-b0aea884febe |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones > Furanochromones |
IUPAC Name | 4-methoxy-7-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]furo[3,2-g]chromen-5-one |
SMILES (Canonical) | COC1=C2C=COC2=CC3=C1C(=O)C=C(O3)COC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC1=C2C=COC2=CC3=C1C(=O)C=C(O3)COC4C(C(C(C(O4)CO)O)O)O |
InChI | InChI=1S/C19H20O10/c1-25-18-9-2-3-26-11(9)5-12-14(18)10(21)4-8(28-12)7-27-19-17(24)16(23)15(22)13(6-20)29-19/h2-5,13,15-17,19-20,22-24H,6-7H2,1H3 |
InChI Key | SJRACCTZSAUMGO-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C19H20O10 |
Molecular Weight | 408.40 g/mol |
Exact Mass | 408.10564683 g/mol |
Topological Polar Surface Area (TPSA) | 148.00 Ų |
XlogP | -0.60 |
NSC82907 |
Khellosid |
SCHEMBL4740196 |
DTXSID50864750 |
CHEBI:182309 |
Q1740621 |
(4-Methoxy-5-oxo-5H-furo[3,2-g][1]benzopyran-7-yl)methyl hexopyranoside |
4-methoxy-7-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]uro[3,2-g]chromen-5-one |
![2D Structure of Vernomycin B 2D Structure of Vernomycin B](https://plantaedb.com/storage/docs/compounds/2023/11/vernomycin-b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.09% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.09% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.18% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.03% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.01% | 98.95% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 89.76% | 95.83% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.60% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.95% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.24% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.92% | 96.00% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 86.29% | 94.03% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.84% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.08% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.66% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.55% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Visnaga daucoides |
PubChem | 28404 |
LOTUS | LTS0124025 |
wikiData | Q105254492 |