Verimol G
Internal ID | 8d5ecff5-4c55-4fbf-8f52-16c82b8bede7 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Phenylpropanes |
IUPAC Name | 1-[1-hydroxy-1-(4-methoxyphenyl)propan-2-yl]oxy-1-(4-methoxyphenyl)propan-2-ol |
SMILES (Canonical) | CC(C(C1=CC=C(C=C1)OC)OC(C)C(C2=CC=C(C=C2)OC)O)O |
SMILES (Isomeric) | CC(C(C1=CC=C(C=C1)OC)OC(C)C(C2=CC=C(C=C2)OC)O)O |
InChI | InChI=1S/C20H26O5/c1-13(21)20(16-7-11-18(24-4)12-8-16)25-14(2)19(22)15-5-9-17(23-3)10-6-15/h5-14,19-22H,1-4H3 |
InChI Key | TXTILWZRXPOUKA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H26O5 |
Molecular Weight | 346.40 g/mol |
Exact Mass | 346.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 68.20 Ų |
XlogP | 2.60 |
CHEBI:175401 |
2-[2-hydroxy-1-(4-methoxyphenyl)propoxy]-1-(4-methoxyphenyl)propan-1-ol |
1-[1-hydroxy-1-(4-methoxyphenyl)propan-2-yl]oxy-1-(4-methoxyphenyl)propan-2-ol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.96% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 95.80% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.22% | 85.14% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 88.76% | 90.24% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.20% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.89% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 85.86% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.66% | 96.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.81% | 93.31% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.47% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.43% | 94.45% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.24% | 90.17% |
CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 82.15% | 91.23% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.24% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Illicium verum |
PubChem | 45360337 |
LOTUS | LTS0211309 |
wikiData | Q105266992 |