Vanicoside E
Internal ID | fd797a05-e7d5-491e-969c-e4c9047f7b86 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Hexacarboxylic acids and derivatives |
IUPAC Name | [(2R,3R,4S,5S)-5-[(2R,3R,4S,5S,6R)-3,5-diacetyloxy-4-hydroxy-6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]oxan-2-yl]oxy-3-hydroxy-4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-5-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]oxolan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC(=O)OC1C(OC(C(C1O)OC(=O)C)OC2(C(C(C(O2)COC(=O)C=CC3=CC=C(C=C3)O)O)OC(=O)C=CC4=CC=C(C=C4)O)COC(=O)C=CC5=CC=C(C=C5)O)COC(=O)C=CC6=CC(=C(C=C6)O)OC |
SMILES (Isomeric) | CC(=O)O[C@@H]1[C@H](O[C@@H]([C@@H]([C@H]1O)OC(=O)C)O[C@]2([C@H]([C@@H]([C@H](O2)COC(=O)/C=C/C3=CC=C(C=C3)O)O)OC(=O)/C=C/C4=CC=C(C=C4)O)COC(=O)/C=C/C5=CC=C(C=C5)O)COC(=O)/C=C/C6=CC(=C(C=C6)O)OC |
InChI | InChI=1S/C53H52O22/c1-30(54)70-49-42(28-68-44(61)24-14-35-10-21-39(59)40(26-35)66-3)72-52(50(48(49)65)71-31(2)55)75-53(29-69-45(62)23-12-33-6-17-37(57)18-7-33)51(73-46(63)25-13-34-8-19-38(58)20-9-34)47(64)41(74-53)27-67-43(60)22-11-32-4-15-36(56)16-5-32/h4-26,41-42,47-52,56-59,64-65H,27-29H2,1-3H3/b22-11+,23-12+,24-14+,25-13+/t41-,42-,47-,48+,49-,50-,51+,52-,53+/m1/s1 |
InChI Key | BVUHZOUVUWDZGR-VAHUYREMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C53H52O22 |
Molecular Weight | 1041.00 g/mol |
Exact Mass | 1040.29502328 g/mol |
Topological Polar Surface Area (TPSA) | 316.00 Ų |
XlogP | 4.80 |
BVUHZOUVUWDZGR-VAHUYREMSA- |
208707-91-9 |
InChI=1/C53H52O22/c1-30(54)70-49-42(28-68-44(61)24-14-35-10-21-39(59)40(26-35)66-3)72-52(50(48(49)65)71-31(2)55)75-53(29-69-45(62)23-12-33-6-17-37(57)18-7-33)51(73-46(63)25-13-34-8-19-38(58)20-9-34)47(64)41(74-53)27-67-43(60)22-11-32-4-15-36(56)16-5-32/h4 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.55% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.70% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.06% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 94.01% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.98% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.44% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.12% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.73% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.63% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.25% | 85.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.06% | 90.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.46% | 95.50% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 87.52% | 97.03% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.18% | 99.17% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.85% | 89.62% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.78% | 91.19% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.74% | 95.89% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.77% | 97.36% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 83.50% | 85.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.99% | 89.67% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.78% | 92.50% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 82.59% | 100.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.38% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 81.60% | 98.95% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.09% | 96.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.06% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Persicaria pensylvanica |
PubChem | 10629901 |
LOTUS | LTS0208668 |
wikiData | Q104946858 |