Urs-12(13)-ene
Internal ID | d63d242c-99c4-4026-8d7e-dd11bf18dba6 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,2R,4aR,6aR,6aS,6bR,8aS,12aS,14bR)-1,2,4a,6a,6b,9,9,12a-octamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene |
SMILES (Canonical) | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCCC5(C)C)C)C)C2C1C)C)C |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CCCC5(C)C)C)C)[C@@H]2[C@H]1C)C)C |
InChI | InChI=1S/C30H50/c1-20-12-16-27(5)18-19-29(7)22(25(27)21(20)2)10-11-24-28(6)15-9-14-26(3,4)23(28)13-17-30(24,29)8/h10,20-21,23-25H,9,11-19H2,1-8H3/t20-,21+,23+,24-,25+,27-,28+,29-,30-/m1/s1 |
InChI Key | DGXIUFDVYPIXCI-XRBCGWODSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H50 |
Molecular Weight | 410.70 g/mol |
Exact Mass | 410.391251595 g/mol |
Topological Polar Surface Area (TPSA) | 0.00 Ų |
XlogP | 10.50 |
464-97-1 |
(1S,2R,4Ar,6aR,6aS,6bR,8aS,12aS,14bR)-1,2,4a,6a,6b,9,9,12a-octamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene |
Urs-12-ene |
ursan-12-ene |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.18% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.52% | 91.11% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.26% | 93.99% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.62% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.59% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.22% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.78% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.31% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.29% | 96.09% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 85.20% | 85.30% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.18% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.78% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.63% | 95.89% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.00% | 99.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.