Urinaligran
Internal ID | 591253fd-3623-4c40-8345-8e13d46ab7e8 |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans > Tetrahydrofuran lignans > 7,7-epoxylignans |
IUPAC Name | 5-[(2R,3S,4S,5S)-5-(1,3-benzodioxol-5-yl)-3,4-bis(methoxymethyl)oxolan-2-yl]-1,3-benzodioxole |
SMILES (Canonical) | COCC1C(C(OC1C2=CC3=C(C=C2)OCO3)C4=CC5=C(C=C4)OCO5)COC |
SMILES (Isomeric) | COC[C@@H]1[C@H]([C@H](O[C@H]1C2=CC3=C(C=C2)OCO3)C4=CC5=C(C=C4)OCO5)COC |
InChI | InChI=1S/C22H24O7/c1-23-9-15-16(10-24-2)22(14-4-6-18-20(8-14)28-12-26-18)29-21(15)13-3-5-17-19(7-13)27-11-25-17/h3-8,15-16,21-22H,9-12H2,1-2H3/t15-,16-,21-,22+/m1/s1 |
InChI Key | OKHVLOVLWZENIM-AJAKECSLSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C22H24O7 |
Molecular Weight | 400.40 g/mol |
Exact Mass | 400.15220310 g/mol |
Topological Polar Surface Area (TPSA) | 64.60 Ų |
XlogP | 2.80 |
1,3-benzodioxole, 5,5'-[(2R,3S,4S,5S)-tetrahydro-3,4-bis(methoxymethyl)-2,5-furandiyl]bis- |
InChI=1/C22H24O7/c1-23-9-15-16(10-24-2)22(14-4-6-18-20(8-14)28-12-26-18)29-21(15)13-3-5-17-19(7-13)27-11-25-17/h3-8,15-16,21-22H,9-12H2,1-2H3/t15-,16-,21-,22+/m1/s |
rel-5,5'-[(2R,3S,4S,5S)-3,4-bis(methoxymethyl)tetrahydrofuran-2,5-diyl]bis(1,3-benzodioxole) |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.78% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.88% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.50% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.02% | 94.45% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 90.46% | 94.80% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.09% | 94.73% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.92% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.18% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.29% | 85.14% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.04% | 96.77% |
CHEMBL2581 | P07339 | Cathepsin D | 86.03% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.60% | 90.00% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.68% | 80.96% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.46% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phyllanthus urinaria |
PubChem | 637287 |
LOTUS | LTS0081252 |
wikiData | Q105193552 |