Umbellulone
| Internal ID | 71ca233a-5658-436e-904e-03e7624f76de |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Bicyclic monoterpenoids |
| IUPAC Name | (1R,5S)-4-methyl-1-propan-2-ylbicyclo[3.1.0]hex-3-en-2-one |
| SMILES (Canonical) | CC1=CC(=O)C2(C1C2)C(C)C |
| SMILES (Isomeric) | CC1=CC(=O)[C@@]2([C@H]1C2)C(C)C |
| InChI | InChI=1S/C10H14O/c1-6(2)10-5-8(10)7(3)4-9(10)11/h4,6,8H,5H2,1-3H3/t8-,10+/m0/s1 |
| InChI Key | LTTVJAQLCIHAFV-WCBMZHEXSA-N |
| Popularity | 9 references in papers |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.104465066 g/mol |
| Topological Polar Surface Area (TPSA) | 17.10 Ų |
| XlogP | 1.60 |
| (-)-Umbellulone |
| 546-78-1 |
| (R)-Umbellulone |
| (1R,5S)-4-Methyl-1-propan-2-ylbicyclo[3.1.0]hex-3-en-2-one |
| (1R,5S)-4-Methyl-1-propan-2-ylbicyclo(3.1.0)hex-3-en-2-one |
| C09911 |
| [1R,5S,(-)]-4-Methyl-1-isopropylbicyclo[3.1.0]hexa-3-ene-2-one |
| AC1L9CYT |
| Umbellol |
| (?)-Umbellulone |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 90.77% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.06% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.14% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.97% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.32% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.20% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.79% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.64% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia capillaris |
| Coptis omeiensis |
| Daucus carota |
| Ocimum gratissimum subsp. gratissimum |
| Pimenta racemosa |
| Tanacetum vulgare |
| Umbellularia californica |
| PubChem | 442504 |
| NPASS | NPC134590 |
| LOTUS | LTS0213292 |
| wikiData | Q99653654 |