Ulexone D
| Internal ID | c065b8c7-912b-42e1-b5b5-06e8acddbcd5 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Pyranoisoflavonoids |
| IUPAC Name | 3-(2,2-dimethylchromen-6-yl)-5-hydroxy-8-(hydroxymethyl)-8-methylpyrano[2,3-h]chromen-4-one |
| SMILES (Canonical) | CC1(C=CC2=C(O1)C=CC(=C2)C3=COC4=C(C3=O)C(=CC5=C4C=CC(O5)(C)CO)O)C |
| SMILES (Isomeric) | CC1(C=CC2=C(O1)C=CC(=C2)C3=COC4=C(C3=O)C(=CC5=C4C=CC(O5)(C)CO)O)C |
| InChI | InChI=1S/C25H22O6/c1-24(2)8-6-15-10-14(4-5-19(15)30-24)17-12-29-23-16-7-9-25(3,13-26)31-20(16)11-18(27)21(23)22(17)28/h4-12,26-27H,13H2,1-3H3 |
| InChI Key | FECHDMKKULRSDG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H22O6 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.14163842 g/mol |
| Topological Polar Surface Area (TPSA) | 85.20 Ų |
| XlogP | 4.20 |
| LMPK12050213 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.29% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.06% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.87% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.49% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.25% | 94.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.46% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.74% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.71% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.74% | 99.15% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.38% | 95.71% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.17% | 93.31% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.45% | 91.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.01% | 94.73% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 82.50% | 85.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.72% | 86.92% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.71% | 91.71% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.68% | 95.78% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.49% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ulex europaeus |
| PubChem | 14583603 |
| LOTUS | LTS0197077 |
| wikiData | Q104993917 |