Ulexone B
Internal ID | edbc8286-9dde-498e-a5d4-3f4ae2fd8ba2 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Pyranoisoflavonoids |
IUPAC Name | 3-(2,2-dimethylchromen-6-yl)-5-hydroxy-8,8-dimethylpyrano[2,3-h]chromen-4-one |
SMILES (Canonical) | CC1(C=CC2=C(O1)C=CC(=C2)C3=COC4=C(C3=O)C(=CC5=C4C=CC(O5)(C)C)O)C |
SMILES (Isomeric) | CC1(C=CC2=C(O1)C=CC(=C2)C3=COC4=C(C3=O)C(=CC5=C4C=CC(O5)(C)C)O)C |
InChI | InChI=1S/C25H22O5/c1-24(2)9-7-15-11-14(5-6-19(15)29-24)17-13-28-23-16-8-10-25(3,4)30-20(16)12-18(26)21(23)22(17)27/h5-13,26H,1-4H3 |
InChI Key | ACNNVOPYPNMOSB-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C25H22O5 |
Molecular Weight | 402.40 g/mol |
Exact Mass | 402.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 65.00 Ų |
XlogP | 5.20 |
CHEBI:185909 |
LMPK12050212 |
3-(2,2-dimethylchromen-6-yl)-5-hydroxy-8,8-dimethylpyrano[2,3-h]chromen-4-one |
3-(2,2-dimethyl-2h-1-benzopyran-6-yl)-5-hydroxy-8,8-dimethyl-4h,8h-benzo[1,2-b:3,4-b']dipyran-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.07% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.70% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.02% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.49% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.83% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.44% | 99.15% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.29% | 94.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.16% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.69% | 85.14% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.34% | 95.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.34% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.98% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.65% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.92% | 94.73% |
CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 81.60% | 85.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.49% | 96.09% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.03% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Flemingia macrophylla |
Maackia amurensis |
Ulex europaeus |
PubChem | 14583601 |
LOTUS | LTS0117177 |
wikiData | Q104400372 |