Tubulosine
Internal ID | fe893580-b0dd-45fc-ac03-b00fdc57d8c6 |
Taxonomy | Alkaloids and derivatives > Harmala alkaloids |
IUPAC Name | (1R)-1-[[(2S,3R,11bS)-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-6-ol |
SMILES (Canonical) | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=C(CCN4)C6=C(N5)C=CC(=C6)O)OC)OC |
SMILES (Isomeric) | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=C(CCN4)C6=C(N5)C=CC(=C6)O)OC)OC |
InChI | InChI=1S/C29H37N3O3/c1-4-17-16-32-10-8-18-13-27(34-2)28(35-3)15-22(18)26(32)12-19(17)11-25-29-21(7-9-30-25)23-14-20(33)5-6-24(23)31-29/h5-6,13-15,17,19,25-26,30-31,33H,4,7-12,16H2,1-3H3/t17-,19-,25+,26-/m0/s1 |
InChI Key | JRVWIILYWSBUMC-PRUVNFMMSA-N |
Popularity | 16 references in papers |
Molecular Formula | C29H37N3O3 |
Molecular Weight | 475.60 g/mol |
Exact Mass | 475.28349205 g/mol |
Topological Polar Surface Area (TPSA) | 69.80 Ų |
XlogP | 4.60 |
Atomic LogP (AlogP) | 5.11 |
H-Bond Acceptor | 5 |
H-Bond Donor | 3 |
Rotatable Bonds | 5 |
Tubulosan-8'-ol, 10,11-dimethoxy- |
2632-29-3 |
Marckine |
CHEBI:9775 |
10,11-Dimethoxytubulosan-8'-ol |
10,11-Dimethoxytubulosanol |
112A6Z7SN5 |
NSC131547 |
NSC 131547 |
NSC-131547 |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of Tubulosine 2D Structure of Tubulosine](https://plantaedb.com/storage/docs/compounds/2023/07/tubulosine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9686 | 96.86% |
Caco-2 | - | 0.5567 | 55.67% |
Blood Brain Barrier | + | 0.6000 | 60.00% |
Human oral bioavailability | - | 0.8286 | 82.86% |
Subcellular localzation | Mitochondria | 0.4811 | 48.11% |
OATP2B1 inhibitior | - | 0.7140 | 71.40% |
OATP1B1 inhibitior | + | 0.8403 | 84.03% |
OATP1B3 inhibitior | + | 0.9268 | 92.68% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.7500 | 75.00% |
BSEP inhibitior | + | 0.9916 | 99.16% |
P-glycoprotein inhibitior | + | 0.7579 | 75.79% |
P-glycoprotein substrate | + | 0.9343 | 93.43% |
CYP3A4 substrate | + | 0.6923 | 69.23% |
CYP2C9 substrate | - | 0.8037 | 80.37% |
CYP2D6 substrate | + | 0.6979 | 69.79% |
CYP3A4 inhibition | - | 0.8797 | 87.97% |
CYP2C9 inhibition | - | 0.9071 | 90.71% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | + | 0.8931 | 89.31% |
CYP1A2 inhibition | - | 0.9046 | 90.46% |
CYP2C8 inhibition | + | 0.6777 | 67.77% |
CYP inhibitory promiscuity | - | 0.8681 | 86.81% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.9600 | 96.00% |
Carcinogenicity (trinary) | Non-required | 0.6931 | 69.31% |
Eye corrosion | - | 0.9887 | 98.87% |
Eye irritation | - | 0.9789 | 97.89% |
Skin irritation | - | 0.7425 | 74.25% |
Skin corrosion | - | 0.9295 | 92.95% |
Ames mutagenesis | - | 0.7300 | 73.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.9531 | 95.31% |
Micronuclear | + | 0.6200 | 62.00% |
Hepatotoxicity | - | 0.7000 | 70.00% |
skin sensitisation | - | 0.8784 | 87.84% |
Respiratory toxicity | + | 0.8222 | 82.22% |
Reproductive toxicity | + | 0.9556 | 95.56% |
Mitochondrial toxicity | + | 0.9500 | 95.00% |
Nephrotoxicity | - | 0.7089 | 70.89% |
Acute Oral Toxicity (c) | III | 0.5935 | 59.35% |
Estrogen receptor binding | + | 0.8168 | 81.68% |
Androgen receptor binding | + | 0.8053 | 80.53% |
Thyroid receptor binding | + | 0.6942 | 69.42% |
Glucocorticoid receptor binding | + | 0.7649 | 76.49% |
Aromatase binding | + | 0.5677 | 56.77% |
PPAR gamma | + | 0.5237 | 52.37% |
Honey bee toxicity | - | 0.7817 | 78.17% |
Biodegradation | - | 0.8500 | 85.00% |
Crustacea aquatic toxicity | + | 0.5551 | 55.51% |
Fish aquatic toxicity | - | 0.3722 | 37.22% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha |
10 nM |
Potency |
via Super-PRED
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
707.9 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.27% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.58% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 98.33% | 92.94% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.52% | 91.11% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.20% | 93.99% |
CHEMBL2535 | P11166 | Glucose transporter | 94.52% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.70% | 97.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.88% | 89.62% |
CHEMBL2581 | P07339 | Cathepsin D | 91.65% | 98.95% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 90.32% | 95.62% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 89.90% | 91.79% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.32% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.01% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.78% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.83% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.60% | 95.89% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 85.97% | 97.64% |
CHEMBL5747 | Q92793 | CREB-binding protein | 85.68% | 95.12% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 85.27% | 88.48% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.74% | 91.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.29% | 95.56% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.24% | 82.38% |
CHEMBL1991 | O14920 | Inhibitor of nuclear factor kappa B kinase beta subunit | 82.85% | 97.15% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.71% | 97.21% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.44% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.42% | 92.62% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 80.47% | 98.59% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.20% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alangium longiflorum |
Carapichea ipecacuanha |
Pogonopus speciosus |
Pogonopus tubulosus |
PubChem | 72341 |
NPASS | NPC280272 |
LOTUS | LTS0223020 |
wikiData | Q27108491 |