Tubocurarine
| Internal ID | 8bc6e4ba-9060-4359-834e-11b142983184 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Ethers > Diarylethers |
| IUPAC Name | (1S,16R)-10,25-dimethoxy-15,15,30-trimethyl-7,23-dioxa-30-aza-15-azoniaheptacyclo[22.6.2.23,6.18,12.118,22.027,31.016,34]hexatriaconta-3(36),4,6(35),8(34),9,11,18(33),19,21,24,26,31-dodecaene-9,21-diol |
| SMILES (Canonical) | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)[N+](CCC6=CC(=C5O)OC)(C)C)OC |
| SMILES (Isomeric) | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C6[C@@H](CC7=CC(=C(C=C7)O)O3)[N+](CCC6=CC(=C5O)OC)(C)C)OC |
| InChI | InChI=1S/C37H40N2O6/c1-38-14-12-24-19-32(42-4)33-21-27(24)28(38)16-22-6-9-26(10-7-22)44-37-35-25(20-34(43-5)36(37)41)13-15-39(2,3)29(35)17-23-8-11-30(40)31(18-23)45-33/h6-11,18-21,28-29H,12-17H2,1-5H3,(H-,40,41)/p+1/t28-,29+/m0/s1 |
| InChI Key | JFJZZMVDLULRGK-URLMMPGGSA-O |
| Popularity | 4,910 references in papers |
| Molecular Formula | C37H41N2O6+ |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.29646203 g/mol |
| Topological Polar Surface Area (TPSA) | 80.60 Ų |
| XlogP | 6.00 |
| Atomic LogP (AlogP) | 6.70 |
| H-Bond Acceptor | 7 |
| H-Bond Donor | 2 |
| Rotatable Bonds | 2 |
| d-Tubocurarine |
| Tubocurarin |
| (+)-Tubocurarine |
| Tubocurarinum |
| 57-95-4 |
| Tubocurarine ion |
| Tubocurarine cation |
| CHEBI:9774 |
| W9YXS298BM |
| 7',12'-Dihydroxy-6,6'-dimethoxy-2,2',2'-trimethyltubocuraranium |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.9659 | 96.59% |
| Caco-2 | - | 0.6580 | 65.80% |
| Blood Brain Barrier | + | 0.6000 | 60.00% |
| Human oral bioavailability | - | 0.7000 | 70.00% |
| Subcellular localzation | Mitochondria | 0.3935 | 39.35% |
| OATP2B1 inhibitior | - | 0.8582 | 85.82% |
| OATP1B1 inhibitior | + | 0.9397 | 93.97% |
| OATP1B3 inhibitior | + | 0.9460 | 94.60% |
| MATE1 inhibitior | + | 0.7200 | 72.00% |
| OCT2 inhibitior | - | 0.6000 | 60.00% |
| BSEP inhibitior | + | 0.9831 | 98.31% |
| P-glycoprotein inhibitior | + | 0.8961 | 89.61% |
| P-glycoprotein substrate | + | 0.6573 | 65.73% |
| CYP3A4 substrate | + | 0.7032 | 70.32% |
| CYP2C9 substrate | + | 0.7936 | 79.36% |
| CYP2D6 substrate | + | 0.4658 | 46.58% |
| CYP3A4 inhibition | - | 0.9284 | 92.84% |
| CYP2C9 inhibition | - | 0.9480 | 94.80% |
| CYP2C19 inhibition | - | 0.9136 | 91.36% |
| CYP2D6 inhibition | - | 0.9231 | 92.31% |
| CYP1A2 inhibition | - | 0.9365 | 93.65% |
| CYP2C8 inhibition | + | 0.6897 | 68.97% |
| CYP inhibitory promiscuity | - | 0.9794 | 97.94% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.9500 | 95.00% |
| Carcinogenicity (trinary) | Non-required | 0.6257 | 62.57% |
| Eye corrosion | - | 0.9862 | 98.62% |
| Eye irritation | - | 0.9410 | 94.10% |
| Skin irritation | - | 0.7906 | 79.06% |
| Skin corrosion | - | 0.9403 | 94.03% |
| Ames mutagenesis | + | 0.7300 | 73.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.9185 | 91.85% |
| Micronuclear | + | 0.6300 | 63.00% |
| Hepatotoxicity | - | 0.9750 | 97.50% |
| skin sensitisation | - | 0.8637 | 86.37% |
| Respiratory toxicity | + | 0.8222 | 82.22% |
| Reproductive toxicity | + | 0.7333 | 73.33% |
| Mitochondrial toxicity | + | 0.7125 | 71.25% |
| Nephrotoxicity | - | 0.9065 | 90.65% |
| Acute Oral Toxicity (c) | III | 0.6856 | 68.56% |
| Estrogen receptor binding | + | 0.6275 | 62.75% |
| Androgen receptor binding | + | 0.7472 | 74.72% |
| Thyroid receptor binding | + | 0.6453 | 64.53% |
| Glucocorticoid receptor binding | + | 0.8757 | 87.57% |
| Aromatase binding | + | 0.7295 | 72.95% |
| PPAR gamma | - | 0.5839 | 58.39% |
| Honey bee toxicity | - | 0.7062 | 70.62% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | + | 0.6500 | 65.00% |
| Fish aquatic toxicity | + | 0.8734 | 87.34% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1743126 | Q96FL8 | Multidrug and toxin extrusion protein 1 |
9400 nM |
IC50 |
PMID: 23241029
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.47% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.40% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.31% | 93.99% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.28% | 92.94% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 94.23% | 95.62% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 94.07% | 91.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.52% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.10% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.78% | 95.89% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.32% | 93.40% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.31% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.92% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.44% | 89.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.04% | 89.62% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.85% | 91.03% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.51% | 94.00% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 87.24% | 97.31% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.23% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.21% | 98.75% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 87.00% | 82.38% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.17% | 92.62% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 83.88% | 91.79% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.08% | 95.78% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.05% | 100.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.59% | 99.15% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.55% | 80.78% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.34% | 89.50% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 80.78% | 96.76% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 80.66% | 82.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.41% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Phellodendron amurense |
| Phellodendron chinense |
| PubChem | 6000 |
| NPASS | NPC90998 |
| ChEMBL | CHEMBL339427 |