Tuberin
| Internal ID | 00d5e31c-49bf-41b0-b75e-bbb5235557ae |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | N-[(E)-2-(4-methoxyphenyl)ethenyl]formamide |
| SMILES (Canonical) | COC1=CC=C(C=C1)C=CNC=O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)/C=C/NC=O |
| InChI | InChI=1S/C10H11NO2/c1-13-10-4-2-9(3-5-10)6-7-11-8-12/h2-8H,1H3,(H,11,12)/b7-6+ |
| InChI Key | SZCZSKMCTGEJKI-VOTSOKGWSA-N |
| Popularity | 2,889 references in papers |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.078978594 g/mol |
| Topological Polar Surface Area (TPSA) | 38.30 Ų |
| XlogP | 1.90 |
| 2501-37-3 |
| Tuberin [MI] |
| Formamide, N-(p-methoxy-trans-styryl)- |
| 53643-53-1 |
| N-trans-(p-Methoxystyryl)formamide |
| N-Formyl trans-p-methoxystyrylamine |
| N-[(E)-2-(4-methoxyphenyl)ethenyl]formamide |
| NSC 7382 |
| 4JG2LF96VF |
| FORMAMIDE, N-(2-(4-METHOXYPHENYL)ETHENYL)- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.85% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.83% | 90.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.24% | 96.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.09% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.34% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.84% | 86.33% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.09% | 85.30% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.50% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Haplophyllum tuberculatum |
| PubChem | 5352006 |
| LOTUS | LTS0119920 |
| wikiData | Q27259753 |