Tryptamine, 7-methoxy-N,N-dimethyl-
| Internal ID | 3048a825-e196-400d-a35f-9fdbb9437a65 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles > 3-alkylindoles |
| IUPAC Name | 1-(7-methoxy-1H-indol-3-yl)-N,N-dimethylmethanamine |
| SMILES (Canonical) | CN(C)CC1=CNC2=C1C=CC=C2OC |
| SMILES (Isomeric) | CN(C)CC1=CNC2=C1C=CC=C2OC |
| InChI | InChI=1S/C12H16N2O/c1-14(2)8-9-7-13-12-10(9)5-4-6-11(12)15-3/h4-7,13H,8H2,1-3H3 |
| InChI Key | QBSJIUXVQLREJU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.126263138 g/mol |
| Topological Polar Surface Area (TPSA) | 28.30 Ų |
| XlogP | 1.90 |
| SCHEMBL837672 |
| QBSJIUXVQLREJU-UHFFFAOYSA-N |
| (7-Methoxy-1H-indol-3-yl)-N,N-dimethylmethanamine # |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.41% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.54% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.60% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.44% | 98.95% |
| CHEMBL228 | P31645 | Serotonin transporter | 91.18% | 95.51% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.82% | 90.08% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.62% | 90.20% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.49% | 98.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.28% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.50% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.11% | 86.33% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 85.99% | 89.44% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.71% | 92.62% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.61% | 96.00% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 85.55% | 85.49% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.97% | 94.75% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 84.64% | 95.48% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.30% | 93.31% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.90% | 89.62% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.37% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.17% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Phalaris aquatica |
| PubChem | 594938 |
| LOTUS | LTS0159527 |
| wikiData | Q105217981 |