Trigoneoside IIA
| Internal ID | 620be803-ba30-482a-aeb1-31202fa0c96c |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2S)-4-[(1R,2S,4S,6R,7S,8R,9S,12S,13S,16S,18R)-6-hydroxy-7,9,13-trimethyl-16-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]oxane-3,4,5-triol |
| SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)COC7C(C(C(CO7)O)O)O)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC[C@H]5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O)O)O)C)C)O[C@@]1(CC[C@H](C)CO[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O |
| InChI | InChI=1S/C44H74O18/c1-19(16-56-40-37(53)34(50)32(48)28(15-45)60-40)7-12-44(55)20(2)30-27(62-44)14-25-23-6-5-21-13-22(8-10-42(21,3)24(23)9-11-43(25,30)4)59-41-38(54)35(51)33(49)29(61-41)18-58-39-36(52)31(47)26(46)17-57-39/h19-41,45-55H,5-18H2,1-4H3/t19-,20-,21+,22-,23+,24-,25-,26+,27-,28+,29+,30-,31-,32+,33+,34-,35-,36+,37+,38+,39-,40+,41+,42-,43-,44+/m0/s1 |
| InChI Key | ISFAETRPBLFKQD-KTNFGKJSSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C44H74O18 |
| Molecular Weight | 891.00 g/mol |
| Exact Mass | 890.48751551 g/mol |
| Topological Polar Surface Area (TPSA) | 287.00 Ų |
| XlogP | 0.20 |
| Atomic LogP (AlogP) | -1.14 |
| H-Bond Acceptor | 18 |
| H-Bond Donor | 11 |
| Rotatable Bonds | 12 |
| Trigoneoside iia, (-)- |
| UNII-35KP0AVB63 |
| 35KP0AVB63 |
| 187141-37-3 |
| beta-D-Glucopyranoside, (3beta,5beta,25S)-26-(beta-D-glucopyranosyloxy)-22-hydroxyfurostan-3-yl 6-o-beta-D-xylopyranosyl- |
| RefChem:52092 |
| Trigoneoside iia (constituent of fenugreek seed) |
| Trigoneoside iia (constituent of fenugreek seed) [DSC] |
| Q27256470 |
| .BETA.-D-GLUCOPYRANOSIDE, (3.BETA.,5.BETA.,25S)-26-(.BETA.-D-GLUCOPYRANOSYLOXY)-22-HYDROXYFUROSTAN-3-YL 6-O-.BETA.-D-XYLOPYRANOSYL- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5246 | 52.46% |
| Caco-2 | - | 0.8822 | 88.22% |
| Blood Brain Barrier | - | 0.6750 | 67.50% |
| Human oral bioavailability | - | 0.7571 | 75.71% |
| Subcellular localzation | Mitochondria | 0.6174 | 61.74% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8800 | 88.00% |
| OATP1B3 inhibitior | + | 0.9480 | 94.80% |
| MATE1 inhibitior | - | 0.9612 | 96.12% |
| OCT2 inhibitior | + | 0.6250 | 62.50% |
| BSEP inhibitior | - | 0.5524 | 55.24% |
| P-glycoprotein inhibitior | + | 0.7380 | 73.80% |
| P-glycoprotein substrate | + | 0.6184 | 61.84% |
| CYP3A4 substrate | + | 0.7523 | 75.23% |
| CYP2C9 substrate | - | 0.8016 | 80.16% |
| CYP2D6 substrate | - | 0.8288 | 82.88% |
| CYP3A4 inhibition | - | 0.9473 | 94.73% |
| CYP2C9 inhibition | - | 0.9215 | 92.15% |
| CYP2C19 inhibition | - | 0.8997 | 89.97% |
| CYP2D6 inhibition | - | 0.9561 | 95.61% |
| CYP1A2 inhibition | - | 0.9215 | 92.15% |
| CYP2C8 inhibition | + | 0.6215 | 62.15% |
| CYP inhibitory promiscuity | - | 0.9616 | 96.16% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.9800 | 98.00% |
| Carcinogenicity (trinary) | Non-required | 0.6223 | 62.23% |
| Eye corrosion | - | 0.9917 | 99.17% |
| Eye irritation | - | 0.9079 | 90.79% |
| Skin irritation | - | 0.6555 | 65.55% |
| Skin corrosion | - | 0.9521 | 95.21% |
| Ames mutagenesis | - | 0.6378 | 63.78% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7584 | 75.84% |
| Micronuclear | - | 0.9100 | 91.00% |
| Hepatotoxicity | - | 0.8533 | 85.33% |
| skin sensitisation | - | 0.9420 | 94.20% |
| Respiratory toxicity | + | 0.6778 | 67.78% |
| Reproductive toxicity | + | 0.7000 | 70.00% |
| Mitochondrial toxicity | - | 0.5375 | 53.75% |
| Nephrotoxicity | - | 0.9133 | 91.33% |
| Acute Oral Toxicity (c) | I | 0.8185 | 81.85% |
| Estrogen receptor binding | + | 0.8198 | 81.98% |
| Androgen receptor binding | + | 0.6070 | 60.70% |
| Thyroid receptor binding | - | 0.5666 | 56.66% |
| Glucocorticoid receptor binding | + | 0.5377 | 53.77% |
| Aromatase binding | + | 0.6644 | 66.44% |
| PPAR gamma | + | 0.7312 | 73.12% |
| Honey bee toxicity | - | 0.6119 | 61.19% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | - | 0.6700 | 67.00% |
| Fish aquatic toxicity | + | 0.7523 | 75.23% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.29% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.91% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.46% | 97.09% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 96.27% | 92.86% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.87% | 97.25% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 95.68% | 95.93% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 94.54% | 94.45% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.09% | 96.61% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.64% | 96.21% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 92.52% | 89.05% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.37% | 94.45% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 92.14% | 98.10% |
| CHEMBL204 | P00734 | Thrombin | 91.94% | 96.01% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 91.91% | 93.18% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.75% | 97.79% |
| CHEMBL233 | P35372 | Mu opioid receptor | 90.72% | 97.93% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.63% | 100.00% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 90.57% | 92.98% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 89.77% | 95.36% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.71% | 96.47% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.34% | 96.77% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 86.60% | 98.05% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 86.60% | 92.50% |
| CHEMBL1871 | P10275 | Androgen Receptor | 86.51% | 96.43% |
| CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 86.34% | 87.38% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 85.87% | 92.32% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 85.33% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.27% | 95.50% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.20% | 97.29% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.11% | 95.89% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.00% | 98.46% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 83.57% | 97.64% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.11% | 82.50% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 82.45% | 80.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.20% | 92.94% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.17% | 92.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.63% | 89.00% |
| CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 81.60% | 96.67% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 81.59% | 97.86% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.99% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.49% | 95.89% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 80.47% | 98.35% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.17% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Trigonella foenum-graecum |