Trigoneoside IB
| Internal ID | 4025cdf6-c0e4-4f07-a164-65db83a0ad6a |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2R)-4-[(1R,2S,4S,6R,7S,8R,9S,12S,13S,15R,16R,18S)-6,15-dihydroxy-7,9,13-trimethyl-16-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CC(C(C5)OC6C(C(C(C(O6)COC7C(C(C(CO7)O)O)O)O)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC[C@@H]5[C@@]4(C[C@H]([C@@H](C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O)O)O)O)C)C)O[C@@]1(CC[C@@H](C)CO[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O |
| InChI | InChI=1S/C44H74O19/c1-18(15-57-40-37(54)34(51)32(49)28(14-45)61-40)7-10-44(56)19(2)30-27(63-44)12-23-21-6-5-20-11-26(24(46)13-43(20,4)22(21)8-9-42(23,30)3)60-41-38(55)35(52)33(50)29(62-41)17-59-39-36(53)31(48)25(47)16-58-39/h18-41,45-56H,5-17H2,1-4H3/t18-,19+,20+,21-,22+,23+,24-,25-,26-,27+,28-,29-,30+,31+,32-,33-,34+,35+,36-,37-,38-,39+,40-,41-,42+,43+,44-/m1/s1 |
| InChI Key | TVNGRDSDHVARNR-SYQAKRSCSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C44H74O19 |
| Molecular Weight | 907.00 g/mol |
| Exact Mass | 906.48243013 g/mol |
| Topological Polar Surface Area (TPSA) | 307.00 Ų |
| XlogP | -0.70 |
| Atomic LogP (AlogP) | -2.17 |
| H-Bond Acceptor | 19 |
| H-Bond Donor | 12 |
| Rotatable Bonds | 12 |
| Trigoneoside ib, (-)- |
| UNII-0E97L8KPHD |
| 0E97L8KPHD |
| 187141-36-2 |
| beta-D-Glucopyranoside, (2alpha,3beta,5alpha,22alpha,25R)-26-(beta-D-glucopyranosyloxy)-2,22-dihydroxyfurostan-3-yl 6-o-beta-D-xylopyranosyl- |
| RefChem:51349 |
| Trigoneoside ib (constituent of fenugreek seed) |
| Trigoneoside ib (constituent of fenugreek seed) [DSC] |
| Q27236670 |
| .BETA.-D-GLUCOPYRANOSIDE, (2.ALPHA.,3.BETA.,5.ALPHA.,22.ALPHA.,25R)-26-(.BETA.-D-GLUCOPYRANOSYLOXY)-2,22-DIHYDROXYFUROSTAN-3-YL 6-O-.BETA.-D-XYLOPYRANOSYL- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5246 | 52.46% |
| Caco-2 | - | 0.8838 | 88.38% |
| Blood Brain Barrier | - | 0.6750 | 67.50% |
| Human oral bioavailability | - | 0.7714 | 77.14% |
| Subcellular localzation | Mitochondria | 0.6174 | 61.74% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8683 | 86.83% |
| OATP1B3 inhibitior | + | 0.9480 | 94.80% |
| MATE1 inhibitior | - | 0.9612 | 96.12% |
| OCT2 inhibitior | + | 0.6250 | 62.50% |
| BSEP inhibitior | - | 0.5125 | 51.25% |
| P-glycoprotein inhibitior | + | 0.7396 | 73.96% |
| P-glycoprotein substrate | + | 0.5864 | 58.64% |
| CYP3A4 substrate | + | 0.7542 | 75.42% |
| CYP2C9 substrate | - | 0.8016 | 80.16% |
| CYP2D6 substrate | - | 0.8288 | 82.88% |
| CYP3A4 inhibition | - | 0.9473 | 94.73% |
| CYP2C9 inhibition | - | 0.9215 | 92.15% |
| CYP2C19 inhibition | - | 0.8997 | 89.97% |
| CYP2D6 inhibition | - | 0.9561 | 95.61% |
| CYP1A2 inhibition | - | 0.9215 | 92.15% |
| CYP2C8 inhibition | + | 0.6567 | 65.67% |
| CYP inhibitory promiscuity | - | 0.9616 | 96.16% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.9800 | 98.00% |
| Carcinogenicity (trinary) | Non-required | 0.6223 | 62.23% |
| Eye corrosion | - | 0.9917 | 99.17% |
| Eye irritation | - | 0.9072 | 90.72% |
| Skin irritation | - | 0.6555 | 65.55% |
| Skin corrosion | - | 0.9521 | 95.21% |
| Ames mutagenesis | - | 0.6878 | 68.78% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7572 | 75.72% |
| Micronuclear | - | 0.9100 | 91.00% |
| Hepatotoxicity | - | 0.8480 | 84.80% |
| skin sensitisation | - | 0.9420 | 94.20% |
| Respiratory toxicity | + | 0.6889 | 68.89% |
| Reproductive toxicity | + | 0.7000 | 70.00% |
| Mitochondrial toxicity | - | 0.5375 | 53.75% |
| Nephrotoxicity | - | 0.9232 | 92.32% |
| Acute Oral Toxicity (c) | I | 0.8185 | 81.85% |
| Estrogen receptor binding | + | 0.8237 | 82.37% |
| Androgen receptor binding | + | 0.6473 | 64.73% |
| Thyroid receptor binding | - | 0.5712 | 57.12% |
| Glucocorticoid receptor binding | + | 0.5414 | 54.14% |
| Aromatase binding | + | 0.6762 | 67.62% |
| PPAR gamma | + | 0.7403 | 74.03% |
| Honey bee toxicity | - | 0.6002 | 60.02% |
| Biodegradation | - | 0.7250 | 72.50% |
| Crustacea aquatic toxicity | - | 0.6300 | 63.00% |
| Fish aquatic toxicity | + | 0.7523 | 75.23% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.47% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.10% | 91.11% |
| CHEMBL204 | P00734 | Thrombin | 97.05% | 96.01% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.89% | 96.61% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 96.85% | 95.93% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 96.78% | 94.45% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 96.67% | 92.86% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.75% | 97.09% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.56% | 96.21% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.20% | 97.25% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.98% | 90.17% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 93.78% | 93.18% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 93.64% | 92.98% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.70% | 100.00% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 90.04% | 89.05% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 89.83% | 98.10% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.65% | 97.79% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 89.39% | 95.36% |
| CHEMBL1871 | P10275 | Androgen Receptor | 88.67% | 96.43% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 87.88% | 92.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.83% | 94.45% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.59% | 95.50% |
| CHEMBL233 | P35372 | Mu opioid receptor | 87.29% | 97.93% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.02% | 96.47% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 86.78% | 98.05% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.74% | 95.89% |
| CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 86.15% | 87.38% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.14% | 96.77% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 85.25% | 99.00% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 85.15% | 100.00% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 85.11% | 97.86% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 84.61% | 92.32% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.78% | 97.29% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.07% | 95.38% |
| CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 82.98% | 96.67% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.49% | 97.14% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.39% | 92.50% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 82.02% | 92.78% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.54% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.43% | 95.89% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.53% | 95.83% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 80.33% | 99.17% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 80.13% | 80.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Trigonella foenum-graecum |