Tridecyl 3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | af031398-3b87-49c5-a726-9631bc23dc98 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | tridecyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CCCCCCCCCCCCCOC(=O)C=CC1=CC(=C(C=C1)O)O |
SMILES (Isomeric) | CCCCCCCCCCCCCOC(=O)C=CC1=CC(=C(C=C1)O)O |
InChI | InChI=1S/C22H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-17-26-22(25)16-14-19-13-15-20(23)21(24)18-19/h13-16,18,23-24H,2-12,17H2,1H3 |
InChI Key | GEGHXTKFDOJTMY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H34O4 |
Molecular Weight | 362.50 g/mol |
Exact Mass | 362.24570956 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 8.40 |
There are no found synonyms. |
![2D Structure of Tridecyl 3-(3,4-dihydroxyphenyl)prop-2-enoate 2D Structure of Tridecyl 3-(3,4-dihydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/tridecyl-3-34-dihydroxyphenylprop-2-enoate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.62% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.08% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.69% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.23% | 99.17% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 94.15% | 80.78% |
CHEMBL2581 | P07339 | Cathepsin D | 93.40% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.08% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 92.69% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.66% | 96.00% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.34% | 92.08% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.48% | 91.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.46% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.23% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.95% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.93% | 89.00% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.76% | 97.29% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.49% | 90.71% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.29% | 92.68% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Daphne oleoides |
PubChem | 145371424 |
LOTUS | LTS0088670 |
wikiData | Q105007149 |