Tricin 7-rutinoside
Internal ID | d3497c0e-45a6-4324-88e2-b95fd773b6d1 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-7-[(2S,4S,5S)-3,4,5-trihydroxy-6-[[(2R,4S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC(=C(C(=C5)OC)O)OC)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1[C@@H]([C@@H](C([C@@H](O1)OCC2[C@H]([C@@H](C([C@@H](O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC(=C(C(=C5)OC)O)OC)O)O)O)O)O)O)O |
InChI | InChI=1S/C29H34O16/c1-10-21(32)24(35)26(37)28(42-10)41-9-19-23(34)25(36)27(38)29(45-19)43-12-6-13(30)20-14(31)8-15(44-16(20)7-12)11-4-17(39-2)22(33)18(5-11)40-3/h4-8,10,19,21,23-30,32-38H,9H2,1-3H3/t10?,19?,21-,23+,24-,25-,26?,27?,28+,29+/m0/s1 |
InChI Key | XQKBGHNKHIYCQA-DMYIILCWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H34O16 |
Molecular Weight | 638.60 g/mol |
Exact Mass | 638.18468499 g/mol |
Topological Polar Surface Area (TPSA) | 244.00 Ų |
XlogP | -0.80 |
CHEBI:168402 |
LMPK12110866 |
5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-7-[(2S,4S,5S)-3,4,5-trihydroxy-6-[[(2R,4S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.56% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.60% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.82% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.27% | 89.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 94.97% | 97.36% |
CHEMBL2581 | P07339 | Cathepsin D | 94.49% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.40% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.70% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.74% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.91% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.51% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 89.31% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.26% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.60% | 99.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.26% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.20% | 86.92% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.13% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.17% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.61% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Setaria italica |
PubChem | 44258273 |
LOTUS | LTS0091097 |
wikiData | Q105339791 |