Tricin 4'-O-(erythro-beta-guaiacylglyceryl) ether
Internal ID | 548ca2bb-01e4-49f2-bf8e-b257ac53dd5f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 3-O-methylated flavonoids |
IUPAC Name | 2-[4-[(1S,2R)-1,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-2-yl]oxy-3,5-dimethoxyphenyl]-5,7-dihydroxychromen-4-one |
SMILES (Canonical) | COC1=CC(=CC(=C1OC(CO)C(C2=CC(=C(C=C2)O)OC)O)OC)C3=CC(=O)C4=C(C=C(C=C4O3)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O[C@H](CO)[C@H](C2=CC(=C(C=C2)O)OC)O)OC)C3=CC(=O)C4=C(C=C(C=C4O3)O)O |
InChI | InChI=1S/C27H26O11/c1-34-20-6-13(4-5-16(20)30)26(33)24(12-28)38-27-22(35-2)7-14(8-23(27)36-3)19-11-18(32)25-17(31)9-15(29)10-21(25)37-19/h4-11,24,26,28-31,33H,12H2,1-3H3/t24-,26+/m1/s1 |
InChI Key | WXNJNHFYIWEHIL-RSXGOPAZSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C27H26O11 |
Molecular Weight | 526.50 g/mol |
Exact Mass | 526.14751164 g/mol |
Topological Polar Surface Area (TPSA) | 164.00 Ų |
XlogP | 2.80 |
Tricin 4'-O-(erythro-beta-guaiacylglyceryl) ether |
369390-52-3 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.72% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.45% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 96.14% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.96% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.37% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.48% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.15% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.61% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.15% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.35% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 90.05% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.45% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.39% | 90.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.08% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.37% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.85% | 90.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 80.80% | 96.12% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.07% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Avena sativa |
PubChem | 21575481 |
LOTUS | LTS0225927 |
wikiData | Q105314778 |