Trichormamide B
Internal ID | b5a45b11-867e-488f-8068-17a7dcd99617 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
IUPAC Name | 3-[(3S,6R,9S,12S,15R,18S,21R,24S,28R,31S,34R,37S)-9,24-bis[(2S)-butan-2-yl]-28-heptyl-3,31-bis[(1R)-1-hydroxyethyl]-18-(2-hydroxyethyl)-6-(hydroxymethyl)-15,21-bis[(1S)-1-hydroxy-2-methylpropyl]-34-[(4-hydroxyphenyl)methyl]-10-methyl-2,5,8,11,14,17,20,23,26,30,33,36-dodecaoxo-1,4,7,10,13,16,19,22,25,29,32,35-dodecazabicyclo[35.3.0]tetracontan-12-yl]propanamide |
SMILES (Canonical) | CCCCCCCC1CC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)NC(C(=O)N1)C(C)O)CC3=CC=C(C=C3)O)C(C)O)CO)C(C)CC)C)CCC(=O)N)C(C(C)C)O)CCO)C(C(C)C)O)C(C)CC |
SMILES (Isomeric) | CCCCCCC[C@@H]1CC(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N2CCC[C@H]2C(=O)N[C@@H](C(=O)N[C@H](C(=O)N1)[C@@H](C)O)CC3=CC=C(C=C3)O)[C@@H](C)O)CO)[C@@H](C)CC)C)CCC(=O)N)[C@H](C(C)C)O)CCO)[C@H](C(C)C)O)[C@@H](C)CC |
InChI | InChI=1S/C69H115N13O20/c1-13-16-17-18-19-21-42-33-50(89)76-51(37(8)14-2)63(96)80-55(58(91)36(6)7)65(98)72-44(29-31-83)59(92)79-54(57(90)35(4)5)66(99)73-45(27-28-49(70)88)68(101)81(12)56(38(9)15-3)67(100)75-47(34-84)61(94)78-53(40(11)86)69(102)82-30-20-22-48(82)62(95)74-46(32-41-23-25-43(87)26-24-41)60(93)77-52(39(10)85)64(97)71-42/h23-26,35-40,42,44-48,51-58,83-87,90-91H,13-22,27-34H2,1-12H3,(H2,70,88)(H,71,97)(H,72,98)(H,73,99)(H,74,95)(H,75,100)(H,76,89)(H,77,93)(H,78,94)(H,79,92)(H,80,96)/t37-,38-,39+,40+,42+,44-,45-,46+,47+,48-,51-,52-,53-,54+,55+,56-,57-,58-/m0/s1 |
InChI Key | MSGPXZILSHWDOB-ZXSGCDKOSA-N |
Popularity | 2 references in papers |
Molecular Formula | C69H115N13O20 |
Molecular Weight | 1446.70 g/mol |
Exact Mass | 1445.83813311 g/mol |
Topological Polar Surface Area (TPSA) | 516.00 Ų |
XlogP | 3.60 |
Atomic LogP (AlogP) | -3.11 |
H-Bond Acceptor | 20 |
H-Bond Donor | 18 |
Rotatable Bonds | 24 |
CHEMBL3326885 |
DTXSID801046584 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8936 | 89.36% |
Caco-2 | - | 0.8615 | 86.15% |
Blood Brain Barrier | - | 0.8750 | 87.50% |
Human oral bioavailability | - | 0.7714 | 77.14% |
Subcellular localzation | Mitochondria | 0.4383 | 43.83% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8164 | 81.64% |
OATP1B3 inhibitior | + | 0.9202 | 92.02% |
MATE1 inhibitior | - | 0.9400 | 94.00% |
OCT2 inhibitior | - | 0.8500 | 85.00% |
BSEP inhibitior | + | 0.9431 | 94.31% |
P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
P-glycoprotein substrate | + | 0.8811 | 88.11% |
CYP3A4 substrate | + | 0.7311 | 73.11% |
CYP2C9 substrate | - | 0.5936 | 59.36% |
CYP2D6 substrate | - | 0.7877 | 78.77% |
CYP3A4 inhibition | - | 0.8602 | 86.02% |
CYP2C9 inhibition | - | 0.8968 | 89.68% |
CYP2C19 inhibition | - | 0.9054 | 90.54% |
CYP2D6 inhibition | - | 0.8980 | 89.80% |
CYP1A2 inhibition | - | 0.9391 | 93.91% |
CYP2C8 inhibition | + | 0.7758 | 77.58% |
CYP inhibitory promiscuity | - | 0.9866 | 98.66% |
UGT catelyzed | + | 1.0000 | 100.00% |
Carcinogenicity (binary) | - | 0.8100 | 81.00% |
Carcinogenicity (trinary) | Non-required | 0.6450 | 64.50% |
Eye corrosion | - | 0.9882 | 98.82% |
Eye irritation | - | 0.8958 | 89.58% |
Skin irritation | - | 0.7815 | 78.15% |
Skin corrosion | - | 0.9111 | 91.11% |
Ames mutagenesis | - | 0.6370 | 63.70% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7107 | 71.07% |
Micronuclear | + | 0.7700 | 77.00% |
Hepatotoxicity | + | 0.5178 | 51.78% |
skin sensitisation | - | 0.8786 | 87.86% |
Respiratory toxicity | + | 0.7000 | 70.00% |
Reproductive toxicity | + | 0.9778 | 97.78% |
Mitochondrial toxicity | + | 0.8875 | 88.75% |
Nephrotoxicity | - | 0.6883 | 68.83% |
Acute Oral Toxicity (c) | III | 0.5810 | 58.10% |
Estrogen receptor binding | + | 0.5989 | 59.89% |
Androgen receptor binding | + | 0.7181 | 71.81% |
Thyroid receptor binding | + | 0.6331 | 63.31% |
Glucocorticoid receptor binding | + | 0.7695 | 76.95% |
Aromatase binding | + | 0.7390 | 73.90% |
PPAR gamma | + | 0.7928 | 79.28% |
Honey bee toxicity | - | 0.7471 | 74.71% |
Biodegradation | - | 0.8250 | 82.50% |
Crustacea aquatic toxicity | - | 0.5909 | 59.09% |
Fish aquatic toxicity | + | 0.6767 | 67.67% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.93% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.45% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.75% | 94.45% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 97.76% | 90.08% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 97.63% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.48% | 97.25% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 96.89% | 82.38% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.72% | 97.29% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 96.38% | 95.89% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 96.06% | 97.64% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 95.05% | 97.79% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.74% | 97.09% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 94.57% | 92.97% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.10% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.88% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.45% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.29% | 91.11% |
CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 91.47% | 97.43% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 91.42% | 90.24% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 91.06% | 91.81% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 90.27% | 98.46% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 90.23% | 95.62% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.12% | 95.50% |
CHEMBL2443 | P49862 | Kallikrein 7 | 89.83% | 94.00% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 89.34% | 95.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.28% | 93.56% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 88.41% | 85.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.35% | 94.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.90% | 86.33% |
CHEMBL4071 | P08311 | Cathepsin G | 86.18% | 94.64% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.87% | 99.18% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.24% | 92.86% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.00% | 82.69% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.77% | 93.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.75% | 89.00% |
CHEMBL3045 | P05771 | Protein kinase C beta | 83.65% | 97.63% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.35% | 93.03% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 83.18% | 88.56% |
CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 82.77% | 88.33% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 82.52% | 97.05% |
CHEMBL299 | P17252 | Protein kinase C alpha | 82.50% | 98.03% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.72% | 100.00% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 80.77% | 96.37% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.76% | 100.00% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.72% | 90.93% |
CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 80.57% | 94.01% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.56% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.46% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sideritis akmanii |
Sideritis argyrea |
Sideritis condensata |
Sideritis congesta |
Sideritis hirsuta |
Sideritis ozturkii |
Sideritis stricta |
PubChem | 118711962 |
LOTUS | LTS0107327 |
wikiData | Q104998929 |