Trichokaurin
Internal ID | d2926b3e-84db-4951-a047-8164413c2774 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | (7-acetyloxy-9,15-dihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-10-yl) acetate |
SMILES (Canonical) | CC(=O)OC1C2C(CCC(C23COC1(C45C3CCC(C4)C(=C)C5OC(=O)C)O)O)(C)C |
SMILES (Isomeric) | CC(=O)OC1C2C(CCC(C23COC1(C45C3CCC(C4)C(=C)C5OC(=O)C)O)O)(C)C |
InChI | InChI=1S/C24H34O7/c1-12-15-6-7-16-22-11-29-24(28,23(16,10-15)19(12)30-13(2)25)20(31-14(3)26)18(22)21(4,5)9-8-17(22)27/h15-20,27-28H,1,6-11H2,2-5H3 |
InChI Key | GLBRPJYMFLHADY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H34O7 |
Molecular Weight | 434.50 g/mol |
Exact Mass | 434.23045342 g/mol |
Topological Polar Surface Area (TPSA) | 102.00 Ų |
XlogP | 1.90 |
23811-50-9 |
CID 91884741 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.16% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.59% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.37% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.93% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.01% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.56% | 91.19% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.37% | 96.77% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.24% | 97.09% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.98% | 95.50% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.79% | 97.28% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.55% | 93.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.16% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.43% | 100.00% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.82% | 82.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.52% | 94.33% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.88% | 96.38% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.66% | 94.75% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.38% | 91.24% |
CHEMBL5028 | O14672 | ADAM10 | 80.00% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon eriocalyx |
Isodon longitubus |
Isodon oresbius |
Isodon rubescens |
Isodon trichocarpus |
PubChem | 12444495 |
LOTUS | LTS0222988 |
wikiData | Q105010771 |