Timosaponin Bii
Internal ID | 4a23ee47-90eb-48a0-91bf-063d4ad26dd6 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2S)-4-[(1R,2S,4S,7S,8R,9S,12S,13S,16S,18R)-16-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC[C@H]5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C)C)OC1(CC[C@H](C)CO[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O |
InChI | InChI=1S/C45H76O19/c1-19(18-58-40-37(55)34(52)31(49)27(15-46)60-40)7-12-45(57)20(2)30-26(64-45)14-25-23-6-5-21-13-22(8-10-43(21,3)24(23)9-11-44(25,30)4)59-42-39(36(54)33(51)29(17-48)62-42)63-41-38(56)35(53)32(50)28(16-47)61-41/h19-42,46-57H,5-18H2,1-4H3/t19-,20-,21+,22-,23+,24-,25-,26-,27+,28+,29+,30-,31+,32+,33-,34-,35-,36-,37+,38+,39+,40+,41-,42+,43-,44-,45?/m0/s1 |
InChI Key | SORUXVRKWOHYEO-FRUGGTEYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C45H76O19 |
Molecular Weight | 921.10 g/mol |
Exact Mass | 920.49808019 g/mol |
Topological Polar Surface Area (TPSA) | 307.00 Ų |
XlogP | 0.70 |
Atomic LogP (AlogP) | -1.78 |
H-Bond Acceptor | 19 |
H-Bond Donor | 12 |
Rotatable Bonds | 13 |
Timosaponin B II |
136656-07-0 |
Prototimosaponin A III |
(2R,3R,4S,5S,6R)-2-[(2S)-4-[(1R,2S,4S,7S,8R,9S,12S,13S,16S,18R)-16-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
Timosaponin B2 |
Prototimosaponin AIII |
CHEMBL454275 |
CHEBI:184112 |
HMS3887C11 |
s9273 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.5246 | 52.46% |
Caco-2 | - | 0.8854 | 88.54% |
Blood Brain Barrier | - | 0.6750 | 67.50% |
Human oral bioavailability | - | 0.8286 | 82.86% |
Subcellular localzation | Mitochondria | 0.6174 | 61.74% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8886 | 88.86% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.9612 | 96.12% |
OCT2 inhibitior | + | 0.6250 | 62.50% |
BSEP inhibitior | - | 0.5523 | 55.23% |
P-glycoprotein inhibitior | + | 0.7407 | 74.07% |
P-glycoprotein substrate | + | 0.5079 | 50.79% |
CYP3A4 substrate | + | 0.7472 | 74.72% |
CYP2C9 substrate | - | 0.8016 | 80.16% |
CYP2D6 substrate | - | 0.8288 | 82.88% |
CYP3A4 inhibition | - | 0.9473 | 94.73% |
CYP2C9 inhibition | - | 0.9215 | 92.15% |
CYP2C19 inhibition | - | 0.8997 | 89.97% |
CYP2D6 inhibition | - | 0.9561 | 95.61% |
CYP1A2 inhibition | - | 0.9215 | 92.15% |
CYP2C8 inhibition | + | 0.5564 | 55.64% |
CYP inhibitory promiscuity | - | 0.9616 | 96.16% |
UGT catelyzed | - | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.6223 | 62.23% |
Eye corrosion | - | 0.9917 | 99.17% |
Eye irritation | - | 0.9080 | 90.80% |
Skin irritation | - | 0.6555 | 65.55% |
Skin corrosion | - | 0.9521 | 95.21% |
Ames mutagenesis | - | 0.7878 | 78.78% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7932 | 79.32% |
Micronuclear | - | 0.9100 | 91.00% |
Hepatotoxicity | - | 0.8377 | 83.77% |
skin sensitisation | - | 0.9420 | 94.20% |
Respiratory toxicity | + | 0.7222 | 72.22% |
Reproductive toxicity | + | 0.7000 | 70.00% |
Mitochondrial toxicity | - | 0.5375 | 53.75% |
Nephrotoxicity | - | 0.8319 | 83.19% |
Acute Oral Toxicity (c) | I | 0.8185 | 81.85% |
Estrogen receptor binding | + | 0.8044 | 80.44% |
Androgen receptor binding | + | 0.6339 | 63.39% |
Thyroid receptor binding | - | 0.5592 | 55.92% |
Glucocorticoid receptor binding | + | 0.5788 | 57.88% |
Aromatase binding | + | 0.6693 | 66.93% |
PPAR gamma | + | 0.7352 | 73.52% |
Honey bee toxicity | - | 0.5845 | 58.45% |
Biodegradation | - | 0.7000 | 70.00% |
Crustacea aquatic toxicity | - | 0.6600 | 66.00% |
Fish aquatic toxicity | + | 0.7523 | 75.23% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.05% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.82% | 91.11% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.18% | 92.86% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.86% | 96.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.42% | 97.09% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 93.17% | 98.05% |
CHEMBL237 | P41145 | Kappa opioid receptor | 92.74% | 98.10% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.71% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.70% | 96.61% |
CHEMBL233 | P35372 | Mu opioid receptor | 91.56% | 97.93% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 91.49% | 89.05% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.52% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.44% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.04% | 97.25% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 89.77% | 95.36% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.67% | 97.79% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 89.49% | 93.18% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 89.13% | 97.64% |
CHEMBL220 | P22303 | Acetylcholinesterase | 88.42% | 94.45% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 88.00% | 95.58% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 86.92% | 97.29% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 86.62% | 92.98% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.08% | 95.89% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.97% | 96.47% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 85.71% | 98.46% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.91% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.67% | 93.56% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.06% | 92.50% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.93% | 95.50% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 83.40% | 97.86% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.87% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.43% | 100.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.42% | 97.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.86% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.47% | 89.00% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 81.47% | 96.31% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 81.45% | 98.35% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.90% | 92.94% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.04% | 92.32% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anemarrhena asphodeloides |