Theanaphthoquinone
| Internal ID | 0bc6593b-a87b-45ba-ad51-000115b51ab8 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Flavan-3-ols |
| IUPAC Name | 8-hydroxy-4,6-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]naphthalene-1,2-dione |
| SMILES (Canonical) | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC4=C(C(=C3)O)C(=O)C(=O)C=C4C5C(CC6=C(C=C(C=C6O5)O)O)O)O |
| SMILES (Isomeric) | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC4=C(C(=C3)O)C(=O)C(=O)C=C4[C@@H]5[C@@H](CC6=C(C=C(C=C6O5)O)O)O)O |
| InChI | InChI=1S/C28H22O11/c29-11-3-17(31)15-8-21(35)27(38-23(15)5-11)10-1-13-14(7-20(34)26(37)25(13)19(33)2-10)28-22(36)9-16-18(32)4-12(30)6-24(16)39-28/h1-7,21-22,27-33,35-36H,8-9H2/t21-,22-,27-,28-/m1/s1 |
| InChI Key | GWOPGSNHEXOQEQ-TUJIQRHUSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C28H22O11 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.11621151 g/mol |
| Topological Polar Surface Area (TPSA) | 194.00 Ų |
| XlogP | 1.60 |
| GWOPGSNHEXOQEQ-TUJIQRHUSA-N |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.52% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.58% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.06% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.77% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.14% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.09% | 91.49% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.90% | 93.40% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.20% | 96.09% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 91.58% | 96.12% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.55% | 99.15% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.18% | 97.09% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 85.13% | 96.37% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.21% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.16% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.57% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Camellia sinensis |
| PubChem | 102571925 |
| LOTUS | LTS0079628 |
| wikiData | Q105022597 |