Theaflavin monogallates
Internal ID | cbf65c18-9359-4c8e-a02a-124eecd1d156 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Catechins |
IUPAC Name | [(2R,3R)-5,7-dihydroxy-2-[3,4,5-trihydroxy-6-oxo-1-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]benzo[7]annulen-8-yl]-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C4=C(C(=O)C=C(C=C34)C5C(CC6=C(C=C(C=C6O5)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C4=C(C(=O)C=C(C=C34)[C@@H]5[C@@H](CC6=C(C=C(C=C6O5)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)O)O |
InChI | InChI=1S/C36H28O16/c37-14-5-20(39)18-10-26(45)35(51-27(18)7-14)17-9-25(44)33(48)30-16(17)1-12(2-24(43)32(30)47)34-29(11-19-21(40)6-15(38)8-28(19)50-34)52-36(49)13-3-22(41)31(46)23(42)4-13/h1-9,26,29,34-35,37-42,44-46,48H,10-11H2,(H,43,47)/t26-,29-,34-,35-/m1/s1 |
InChI Key | KMJPKUVSXFVQGZ-WQLSNUALSA-N |
Popularity | 3 references in papers |
Molecular Formula | C36H28O16 |
Molecular Weight | 716.60 g/mol |
Exact Mass | 716.13773480 g/mol |
Topological Polar Surface Area (TPSA) | 284.00 Ų |
XlogP | 1.80 |
THEAFLAVINE-3-GALLATE |
Theaflavin monogallate A |
S6469PF6TK |
Benzoic acid, 3,4,5-trihydroxy-, 2-(1-(3,4-dihydro-3,5,7-trihydroxy-2H-1-benzopyran-2-yl)-3,4,6-trihydroxy-5-oxo-5H-benzocyclohepten-8-yl)-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-3-yl ester, (2R-(2alpha(2R*,3R*),3alpha))- |
Benzoic acid, 3,4,5-trihydroxy-, 2-[1-(3,4-dihydro-3,5,7-trihydroxy-2H-1-benzopyran-2-yl)-3,4,6-trihydroxy-5-oxo-5H-benzocyclohepten-8-yl]-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-3-yl ester, [2R-[2alpha(2R*,3R*),3alpha]]- |
Spectrum_000318 |
SpecPlus_000279 |
Spectrum2_000162 |
Spectrum3_000252 |
Spectrum4_001542 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.75% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.56% | 91.49% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 96.25% | 92.98% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.84% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.61% | 98.95% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 93.37% | 83.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.31% | 99.23% |
CHEMBL3194 | P02766 | Transthyretin | 92.77% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.92% | 95.64% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 91.91% | 96.37% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.95% | 86.33% |
CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 90.48% | 95.55% |
CHEMBL2535 | P11166 | Glucose transporter | 89.44% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.32% | 97.09% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 88.59% | 96.12% |
CHEMBL1993 | P26358 | DNA (cytosine-5)-methyltransferase 1 | 87.93% | 95.44% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.62% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.55% | 96.09% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 85.11% | 91.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.49% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.46% | 95.89% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 81.97% | 92.67% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.07% | 96.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.88% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.13% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camellia sinensis |
PubChem | 169167 |
LOTUS | LTS0081490 |
wikiData | Q72508145 |