Thapsakinacetate A
Internal ID | 4b1c56e0-60eb-4cfe-8f5d-5227ea2439de |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 5-O-methylated flavonoids |
IUPAC Name | methyl (1R,12R,13S,14R,15R)-1-hydroxy-3-methoxy-12-(4-methoxyphenyl)-14-[2-(2-methylpropanoylamino)pyrrolidine-1-carbonyl]-13-phenyl-5,7,11-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-triene-15-carboxylate |
SMILES (Canonical) | CC(C)C(=O)NC1CCCN1C(=O)C2C(C3(C(C2(C4=C(C5=C(C=C4O3)OCO5)OC)O)C(=O)OC)C6=CC=C(C=C6)OC)C7=CC=CC=C7 |
SMILES (Isomeric) | CC(C)C(=O)NC1CCCN1C(=O)[C@@H]2[C@H]([C@@]3([C@@H]([C@]2(C4=C(C5=C(C=C4O3)OCO5)OC)O)C(=O)OC)C6=CC=C(C=C6)OC)C7=CC=CC=C7 |
InChI | InChI=1S/C37H40N2O10/c1-20(2)33(40)38-26-12-9-17-39(26)34(41)29-27(21-10-7-6-8-11-21)37(22-13-15-23(44-3)16-14-22)32(35(42)46-5)36(29,43)28-24(49-37)18-25-30(31(28)45-4)48-19-47-25/h6-8,10-11,13-16,18,20,26-27,29,32,43H,9,12,17,19H2,1-5H3,(H,38,40)/t26?,27-,29+,32-,36-,37-/m1/s1 |
InChI Key | NIWPPADQQDYTAA-TWRNWBRFSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C37H40N2O10 |
Molecular Weight | 672.70 g/mol |
Exact Mass | 672.26829548 g/mol |
Topological Polar Surface Area (TPSA) | 142.00 Ų |
XlogP | 4.20 |
CHEMBL2269307 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.59% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.27% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.09% | 98.95% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.69% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.51% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.30% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.88% | 94.45% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 93.35% | 99.18% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.05% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.84% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.79% | 92.62% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.41% | 93.99% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.28% | 90.00% |
CHEMBL204 | P00734 | Thrombin | 90.60% | 96.01% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.73% | 97.09% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.70% | 93.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.56% | 90.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.04% | 96.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.63% | 91.19% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.03% | 99.23% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.60% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.31% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.96% | 86.33% |
CHEMBL5028 | O14672 | ADAM10 | 83.71% | 97.50% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 82.18% | 98.33% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 81.69% | 96.25% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 81.54% | 97.53% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.54% | 100.00% |
CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 80.50% | 82.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aglaia edulis |
PubChem | 76308670 |
LOTUS | LTS0084807 |
wikiData | Q105180022 |