Tetrandrine N2'-oxide
Internal ID | b38172fb-d0fe-4e77-879d-7323013738c7 |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | (1S,14S)-9,20,21,25-tetramethoxy-15,30-dimethyl-30-oxido-7,23-dioxa-15-aza-30-azoniaheptacyclo[22.6.2.23,6.18,12.114,18.027,31.022,33]hexatriaconta-3(36),4,6(35),8,10,12(34),18,20,22(33),24,26,31-dodecaene |
SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=CC(=C(C=C4)OC)OC5=CC=C(CC6C7=CC(=C(C=C7CC[N+]6(C)[O-])OC)O3)C=C5)OC)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC(=C(C=C4)OC)OC5=CC=C(C[C@H]6C7=CC(=C(C=C7CC[N+]6(C)[O-])OC)O3)C=C5)OC)OC |
InChI | InChI=1S/C38H42N2O7/c1-39-15-13-26-21-35(44-5)37(45-6)38-36(26)29(39)17-24-9-12-31(42-3)33(19-24)46-27-10-7-23(8-11-27)18-30-28-22-34(47-38)32(43-4)20-25(28)14-16-40(30,2)41/h7-12,19-22,29-30H,13-18H2,1-6H3/t29-,30-,40?/m0/s1 |
InChI Key | XOKSQIGOCSEXEF-NGYPEZQGSA-N |
Popularity | 2 references in papers |
Molecular Formula | C38H42N2O7 |
Molecular Weight | 638.70 g/mol |
Exact Mass | 638.29920168 g/mol |
Topological Polar Surface Area (TPSA) | 76.70 Ų |
XlogP | 6.10 |
CHEMBL510782 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.49% | 96.09% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.44% | 93.40% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 96.36% | 96.76% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 95.10% | 91.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.88% | 93.99% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 94.27% | 95.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.44% | 95.56% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 90.11% | 92.98% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.83% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.77% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 89.52% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 88.49% | 98.75% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 86.76% | 97.31% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.35% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.23% | 95.89% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 86.22% | 100.00% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 85.81% | 92.38% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.65% | 95.78% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.63% | 89.62% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.09% | 82.38% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.59% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.79% | 89.00% |
CHEMBL5747 | Q92793 | CREB-binding protein | 83.69% | 95.12% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.54% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.37% | 99.17% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 83.32% | 96.86% |
CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 82.44% | 96.69% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 81.70% | 82.67% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 81.04% | 90.95% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.81% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anthocercis viscosa |
Brugmansia arborea |
Cyclea barbata |
Schizanthus litoralis |
PubChem | 44559015 |
NPASS | NPC10871 |
ChEMBL | CHEMBL510782 |
LOTUS | LTS0219673 |
wikiData | Q105337793 |