Teicoplanin A2-4
Internal ID | 1e76a32d-f17e-41d7-b9a6-f2c7bef63c02 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
IUPAC Name | (1S,2R,19R,22R,34S,37R,40R,52S)-2-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-22-amino-5,15-dichloro-64-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(8-methyldecanoylamino)oxan-2-yl]oxy-26,31,44,49-tetrahydroxy-21,35,38,54,56,59-hexaoxo-47-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7,13,28-trioxa-20,36,39,53,55,58-hexazaundecacyclo[38.14.2.23,6.214,17.219,34.18,12.123,27.129,33.141,45.010,37.046,51]hexahexaconta-3,5,8,10,12(64),14,16,23(61),24,26,29(60),30,32,41(57),42,44,46(51),47,49,62,65-henicosaene-52-carboxylic acid |
SMILES (Canonical) | CCC(C)CCCCCCC(=O)NC1C(C(C(OC1OC2=C3C=C4C=C2OC5=C(C=C(C=C5)C(C6C(=O)NC(C7=C(C(=CC(=C7)O)OC8C(C(C(C(O8)CO)O)O)O)C9=C(C=CC(=C9)C(C(=O)N6)NC(=O)C4NC(=O)C1C2=CC(=CC(=C2)OC2=C(C=CC(=C2)C(C(=O)NC(CC2=CC(=C(O3)C=C2)Cl)C(=O)N1)N)O)O)O)C(=O)O)OC1C(C(C(C(O1)CO)O)O)NC(=O)C)Cl)CO)O)O |
SMILES (Isomeric) | CCC(C)CCCCCCC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1OC2=C3C=C4C=C2OC5=C(C=C(C=C5)[C@H]([C@H]6C(=O)N[C@@H](C7=C(C(=CC(=C7)O)O[C@@H]8[C@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)C9=C(C=CC(=C9)[C@H](C(=O)N6)NC(=O)[C@@H]4NC(=O)[C@@H]1C2=CC(=CC(=C2)OC2=C(C=CC(=C2)[C@H](C(=O)N[C@H](CC2=CC(=C(O3)C=C2)Cl)C(=O)N1)N)O)O)O)C(=O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)NC(=O)C)Cl)CO)O)O |
InChI | InChI=1S/C89H99Cl2N9O33/c1-4-34(2)9-7-5-6-8-10-61(109)95-69-75(114)72(111)59(32-102)130-88(69)133-79-56-26-41-27-57(79)127-53-18-14-39(24-48(53)91)78(132-87-68(93-35(3)104)74(113)71(110)58(31-101)129-87)70-85(122)99-67(86(123)124)46-29-43(106)30-55(128-89-77(116)76(115)73(112)60(33-103)131-89)62(46)45-23-38(13-15-50(45)107)64(82(119)100-70)97-84(121)66(41)98-83(120)65-40-21-42(105)28-44(22-40)125-54-25-37(12-16-51(54)108)63(92)81(118)94-49(80(117)96-65)20-36-11-17-52(126-56)47(90)19-36/h11-19,21-30,34,49,58-60,63-78,87-89,101-103,105-108,110-116H,4-10,20,31-33,92H2,1-3H3,(H,93,104)(H,94,118)(H,95,109)(H,96,117)(H,97,121)(H,98,120)(H,99,122)(H,100,119)(H,123,124)/t34?,49-,58-,59-,60-,63-,64-,65+,66-,67+,68-,69-,70+,71-,72-,73-,74-,75-,76+,77+,78-,87+,88+,89+/m1/s1 |
InChI Key | KSPOYQQCANXEDC-WNTLLCOUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C89H99Cl2N9O33 |
Molecular Weight | 1893.70 g/mol |
Exact Mass | 1891.5722320 g/mol |
Topological Polar Surface Area (TPSA) | 662.00 Ų |
XlogP | 0.80 |
Atomic LogP (AlogP) | 1.41 |
H-Bond Acceptor | 33 |
H-Bond Donor | 24 |
Rotatable Bonds | 20 |
83Q83MG55O |
Teichomycin A2 factor 4 |
Teichomycin A2-4 |
91032-37-0 |
34-O-(2-(Acetylamino)-2-deoxy-beta-D-glucopyranosyl)-22,31-dichloro-7-demethyl-64-O-demethyl-19-deoxy-56-O-(2-deoxy-2-((8-methyl-1-oxodecyl)amino)-beta-D-glucopyranosyl)-42-O-alpha-D-mannopyranosylristomycin A aglycone |
C13610 |
T-A2-4 |
UNII-83Q83MG55O |
CHEMBL4297105 |
Teichomycin A(sub 2) factor 4 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7140 | 71.40% |
Caco-2 | - | 0.8582 | 85.82% |
Blood Brain Barrier | - | 0.8500 | 85.00% |
Human oral bioavailability | - | 0.8286 | 82.86% |
Subcellular localzation | Nucleus | 0.4199 | 41.99% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8098 | 80.98% |
OATP1B3 inhibitior | + | 0.9142 | 91.42% |
MATE1 inhibitior | - | 0.9200 | 92.00% |
OCT2 inhibitior | - | 0.9750 | 97.50% |
BSEP inhibitior | + | 0.9569 | 95.69% |
P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
P-glycoprotein substrate | + | 0.8411 | 84.11% |
CYP3A4 substrate | + | 0.7597 | 75.97% |
CYP2C9 substrate | - | 0.8057 | 80.57% |
CYP2D6 substrate | - | 0.8447 | 84.47% |
CYP3A4 inhibition | - | 0.6007 | 60.07% |
CYP2C9 inhibition | - | 0.8723 | 87.23% |
CYP2C19 inhibition | - | 0.7763 | 77.63% |
CYP2D6 inhibition | - | 0.8409 | 84.09% |
CYP1A2 inhibition | - | 0.8214 | 82.14% |
CYP2C8 inhibition | + | 0.8693 | 86.93% |
CYP inhibitory promiscuity | - | 0.7823 | 78.23% |
UGT catelyzed | + | 0.9000 | 90.00% |
Carcinogenicity (binary) | - | 0.7300 | 73.00% |
Carcinogenicity (trinary) | Non-required | 0.5453 | 54.53% |
Eye corrosion | - | 0.9858 | 98.58% |
Eye irritation | - | 0.8954 | 89.54% |
Skin irritation | - | 0.7651 | 76.51% |
Skin corrosion | - | 0.9322 | 93.22% |
Ames mutagenesis | - | 0.5200 | 52.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7429 | 74.29% |
Micronuclear | + | 0.8200 | 82.00% |
Hepatotoxicity | + | 0.6233 | 62.33% |
skin sensitisation | - | 0.8549 | 85.49% |
Respiratory toxicity | + | 0.8111 | 81.11% |
Reproductive toxicity | + | 0.9333 | 93.33% |
Mitochondrial toxicity | + | 0.9375 | 93.75% |
Nephrotoxicity | + | 0.7354 | 73.54% |
Acute Oral Toxicity (c) | III | 0.6366 | 63.66% |
Estrogen receptor binding | + | 0.5310 | 53.10% |
Androgen receptor binding | + | 0.7595 | 75.95% |
Thyroid receptor binding | + | 0.8434 | 84.34% |
Glucocorticoid receptor binding | + | 0.8305 | 83.05% |
Aromatase binding | + | 0.7621 | 76.21% |
PPAR gamma | + | 0.7809 | 78.09% |
Honey bee toxicity | - | 0.6254 | 62.54% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | + | 0.5100 | 51.00% |
Fish aquatic toxicity | + | 0.9495 | 94.95% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL220 | P22303 | Acetylcholinesterase | 99.99% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.93% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 99.92% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.34% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.95% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.35% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.68% | 97.09% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.23% | 93.56% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 95.48% | 96.21% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 94.73% | 89.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.18% | 94.73% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 93.99% | 89.62% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.45% | 99.15% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 93.21% | 92.29% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 92.05% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.22% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.07% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.93% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 90.07% | 98.75% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.82% | 96.61% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.66% | 95.89% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 88.35% | 85.00% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 87.95% | 97.23% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.83% | 96.47% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.96% | 91.19% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.91% | 97.21% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.19% | 92.50% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.15% | 96.95% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.91% | 96.90% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.38% | 100.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.76% | 97.79% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.27% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.87% | 96.00% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 81.31% | 95.71% |
CHEMBL236 | P41143 | Delta opioid receptor | 80.59% | 99.35% |
CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 80.02% | 95.48% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bicuiba oleifera |
Peperomia blanda |
Peperomia heyneana |
PubChem | 17748672 |
LOTUS | LTS0076059 |
wikiData | Q104920208 |