taepeenin D
Internal ID | 673a514c-5505-4989-b68d-61f591d1263c |
Taxonomy | Benzenoids > Phenanthrenes and derivatives |
IUPAC Name | methyl (4R,4aR,5R,11bS)-5-acetyloxy-4,7,11b-trimethyl-1,2,3,4a,5,6-hexahydronaphtho[2,1-f][1]benzofuran-4-carboxylate |
SMILES (Canonical) | CC1=C2CC(C3C(C2=CC4=C1C=CO4)(CCCC3(C)C(=O)OC)C)OC(=O)C |
SMILES (Isomeric) | CC1=C2C[C@H]([C@@H]3[C@@](C2=CC4=C1C=CO4)(CCC[C@@]3(C)C(=O)OC)C)OC(=O)C |
InChI | InChI=1S/C23H28O5/c1-13-15-7-10-27-18(15)12-17-16(13)11-19(28-14(2)24)20-22(17,3)8-6-9-23(20,4)21(25)26-5/h7,10,12,19-20H,6,8-9,11H2,1-5H3/t19-,20-,22-,23-/m1/s1 |
InChI Key | KUDGKETXNRKTHI-OHUMZHCVSA-N |
Popularity | 2 references in papers |
Molecular Formula | C23H28O5 |
Molecular Weight | 384.50 g/mol |
Exact Mass | 384.19367399 g/mol |
Topological Polar Surface Area (TPSA) | 65.70 Ų |
XlogP | 5.00 |
CHEMBL1096147 |
methyl (4R,4aR,5R,11bS)-5-acetyloxy-4,7,11b-trimethyl-1,2,3,4a,5,6-hexahydronaphtho[2,1-f][1]benzofuran-4-carboxylate |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.58% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.65% | 94.45% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.83% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.79% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 90.40% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.02% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.74% | 95.56% |
CHEMBL240 | Q12809 | HERG | 86.94% | 89.76% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.71% | 89.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.44% | 91.07% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.57% | 94.80% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.07% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.98% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.95% | 94.00% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 82.24% | 96.39% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.79% | 91.19% |
CHEMBL5028 | O14672 | ADAM10 | 81.61% | 97.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.16% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Andrographis lineata |
Baccharis patagonica |
Hoya australis |
Senegalia pennata |
Thalictrum speciosissimum |
PubChem | 11703693 |
NPASS | NPC95526 |
ChEMBL | CHEMBL1096147 |
LOTUS | LTS0202908 |
wikiData | Q105146093 |