Taccalonolide A
Internal ID | be6a36e0-b4d8-4d8f-8642-3151b2fde4c1 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
IUPAC Name | [(1S,2S,3R,5S,7S,9S,10R,11R,12S,13S,14R,15R,16S,17S,22S,23S,24R,25R)-10,14,25-triacetyloxy-3,22-dihydroxy-11,15,17,22,23-pentamethyl-4,21-dioxo-8,20-dioxaheptacyclo[13.10.0.02,12.05,11.07,9.016,24.019,23]pentacos-18-en-13-yl] acetate |
SMILES (Canonical) | CC1C=C2C(C3C1C4(C(C3OC(=O)C)C5C(C(C4OC(=O)C)OC(=O)C)C6(C(CC7C(C6OC(=O)C)O7)C(=O)C5O)C)C)(C(C(=O)O2)(C)O)C |
SMILES (Isomeric) | C[C@@H]1C=C2[C@@]([C@H]3[C@H]1[C@@]4([C@@H]([C@H]3OC(=O)C)[C@H]5[C@H]([C@@H]([C@@H]4OC(=O)C)OC(=O)C)[C@@]6([C@H](C[C@H]7[C@@H]([C@@H]6OC(=O)C)O7)C(=O)[C@@H]5O)C)C)([C@](C(=O)O2)(C)O)C |
InChI | InChI=1S/C36H46O14/c1-12-10-19-35(8,36(9,44)32(43)50-19)24-21(12)34(7)22(28(24)45-13(2)37)20-23(29(46-14(3)38)31(34)48-16(5)40)33(6)17(25(41)26(20)42)11-18-27(49-18)30(33)47-15(4)39/h10,12,17-18,20-24,26-31,42,44H,11H2,1-9H3/t12-,17-,18+,20+,21+,22-,23-,24+,26-,27+,28-,29+,30+,31+,33+,34-,35+,36-/m1/s1 |
InChI Key | PTTJLTMUKRRHAT-VJAKQJMOSA-N |
Popularity | 13 references in papers |
Molecular Formula | C36H46O14 |
Molecular Weight | 702.70 g/mol |
Exact Mass | 702.28875614 g/mol |
Topological Polar Surface Area (TPSA) | 202.00 Ų |
XlogP | 1.70 |
108885-68-3 |
CHEBI:9388 |
CHEMBL1821838 |
AC1L9BGV |
C08635 |
[(1S,2S,3R,5S,7S,9S,10R,11R,12S,13S,14R,15R,16S,17S,22S,23S,24R,25R)-10,14,25-triacetyloxy-3,22-dihydroxy-11,15,17,22,23-pentamethyl-4,21-dioxo-8,20-dioxaheptacyclo[13.10.0.02,12.05,11.07,9.016,24.019,23]pentacos-18-en-13-yl] acetate |
DTXSID80910895 |
PTTJLTMUKRRHAT-VJAKQJMOSA-N |
HY-N2416 |
AKOS037515195 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.98% | 94.45% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.26% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.32% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.96% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.55% | 86.33% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.56% | 96.77% |
CHEMBL2581 | P07339 | Cathepsin D | 92.46% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.14% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.56% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.46% | 97.25% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.57% | 91.19% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.15% | 94.00% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 85.92% | 92.51% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.67% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.10% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.00% | 93.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.65% | 90.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.97% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.67% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.61% | 92.94% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.03% | 94.73% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.81% | 85.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.22% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.19% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anthriscus sylvestris |
Tacca chantrieri |
Tacca plantaginea |
PubChem | 441685 |
NPASS | NPC65858 |
ChEMBL | CHEMBL1821838 |
LOTUS | LTS0115343 |
wikiData | Q27108373 |