Strophalloside
Internal ID | fa43a62a-9d42-4bae-8779-99c819b91996 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Cardenolides and derivatives > Cardenolide glycosides and derivatives |
IUPAC Name | (3S,5S,8R,9S,10S,13R,14S,17R)-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2CCC3(C4CCC5(C(CCC5(C4CCC3(C2)O)O)C6=CC(=O)OC6)C)C=O)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@H]([C@H]([C@@H](O1)O[C@H]2CC[C@@]3([C@H]4CC[C@@]5([C@H](CC[C@@]5([C@@H]4CC[C@@]3(C2)O)O)C6=CC(=O)OC6)C)C=O)O)O)O |
InChI | InChI=1S/C29H42O10/c1-15-22(32)23(33)24(34)25(38-15)39-17-3-8-27(14-30)19-4-7-26(2)18(16-11-21(31)37-13-16)6-10-29(26,36)20(19)5-9-28(27,35)12-17/h11,14-15,17-20,22-25,32-36H,3-10,12-13H2,1-2H3/t15-,17+,18-,19+,20-,22-,23-,24-,25+,26-,27+,28+,29+/m1/s1 |
InChI Key | HULMNSIAKWANQO-ABOSTDGNSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C29H42O10 |
Molecular Weight | 550.60 g/mol |
Exact Mass | 550.27779753 g/mol |
Topological Polar Surface Area (TPSA) | 163.00 Ų |
XlogP | -0.70 |
DTXSID401317296 |
(3S,5S,8R,9S,10S,13R,14S,17R)-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
39.8 nM |
Potency |
via Super-PRED
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
223.9 nM 281.8 nM |
Potency Potency |
via Super-PRED
via Super-PRED |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.26% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.21% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 95.54% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.71% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.08% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.68% | 97.36% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.84% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.43% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.12% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.97% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.26% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.16% | 95.89% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.24% | 90.24% |
CHEMBL2581 | P07339 | Cathepsin D | 86.05% | 98.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.99% | 92.94% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.78% | 91.71% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.42% | 96.77% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.94% | 93.40% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.61% | 85.14% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.15% | 95.93% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.11% | 94.78% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.04% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Antiaris toxicaria |
Streblus asper |
PubChem | 23618277 |
LOTUS | LTS0125409 |
wikiData | Q105033898 |