Strongylophorine-3
Internal ID | 656c046d-48c9-48dc-9b5c-96dcb6475220 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthenes |
IUPAC Name | (1R,2S,11S,14R,15R,19S,20R)-6-hydroxy-1,11,15,19-tetramethyl-10-oxapentacyclo[12.8.0.02,11.04,9.015,20]docosa-4(9),5,7-triene-19-carboxylic acid |
SMILES (Canonical) | CC12CCCC(C1CCC3(C2CCC4(C3CC5=C(O4)C=CC(=C5)O)C)C)(C)C(=O)O |
SMILES (Isomeric) | C[C@]12CCC[C@]([C@@H]1CC[C@@]3([C@@H]2CC[C@]4([C@H]3CC5=C(O4)C=CC(=C5)O)C)C)(C)C(=O)O |
InChI | InChI=1S/C26H36O4/c1-23-10-5-11-25(3,22(28)29)20(23)8-12-24(2)19(23)9-13-26(4)21(24)15-16-14-17(27)6-7-18(16)30-26/h6-7,14,19-21,27H,5,8-13,15H2,1-4H3,(H,28,29)/t19-,20-,21+,23-,24-,25+,26+/m1/s1 |
InChI Key | SSYYQRHNVQFDDJ-OTUFAOMXSA-N |
Popularity | 4 references in papers |
Molecular Formula | C26H36O4 |
Molecular Weight | 412.60 g/mol |
Exact Mass | 412.26135963 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 6.30 |
Strongylophorin-3 |
CHEMBL466374 |
BDBM50115388 |
70214-93-6 |
![2D Structure of Strongylophorine-3 2D Structure of Strongylophorine-3](https://plantaedb.com/storage/docs/compounds/2023/07/strongylophorine-3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B |
9000 nM |
IC50 |
PMID: 26253631
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.33% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.52% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 91.17% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.78% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.13% | 95.56% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 87.72% | 95.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.09% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.94% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.69% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.06% | 100.00% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.47% | 85.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.81% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.22% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Stephania pierrei |
PubChem | 14564364 |
NPASS | NPC79372 |
ChEMBL | CHEMBL466374 |
LOTUS | LTS0271259 |
wikiData | Q105260040 |