Squamulosone
Internal ID | af18ae26-573d-4b70-889d-3286c786e111 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Aromadendrane sesquiterpenoids > 5,10-cycloaromadendrane sesquiterpenoids |
IUPAC Name | (1aR,7R,7aS,7bR)-1,1,4,7-tetramethyl-2,5,6,7,7a,7b-hexahydro-1aH-cyclopropa[e]azulen-3-one |
SMILES (Canonical) | CC1CCC2=C(C(=O)CC3C(C12)C3(C)C)C |
SMILES (Isomeric) | C[C@@H]1CCC2=C(C(=O)C[C@@H]3[C@H]([C@H]12)C3(C)C)C |
InChI | InChI=1S/C15H22O/c1-8-5-6-10-9(2)12(16)7-11-14(13(8)10)15(11,3)4/h8,11,13-14H,5-7H2,1-4H3/t8-,11-,13-,14-/m1/s1 |
InChI Key | FUIPJCVSKAWFTI-KLPZLMTLSA-N |
Popularity | 9 references in papers |
Molecular Formula | C15H22O |
Molecular Weight | 218.33 g/mol |
Exact Mass | 218.167065321 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 3.10 |
34413-94-0 |
(1aR,7R,7aS,7bR)-1,1,4,7-tetramethyl-2,5,6,7,7a,7b-hexahydro-1aH-cyclopropa[e]azulen-3-one |
AC1LCS8N |
Aromadendr-1(10)-en-9-one |
DTXSID90348367 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.90% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.69% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.40% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.39% | 96.09% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.85% | 96.43% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 85.80% | 86.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.10% | 97.09% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.96% | 93.03% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.75% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.27% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 81.20% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.93% | 90.17% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.22% | 94.75% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.15% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Acorus calamus |
Acorus calamus var. angustatus |
Acorus gramineus |
Condea verticillata |
PubChem | 636442 |
NPASS | NPC115787 |
LOTUS | LTS0266320 |
wikiData | Q82123117 |