squadiolin A
Internal ID | f7c9c98e-f872-455d-b8ed-bb74484e075d |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Annonaceous acetogenins |
IUPAC Name | (2S)-4-[(13R,14R,17R)-17-[(2R,5R)-5-[(1S)-1,5-dihydroxyundecyl]oxolan-2-yl]-13,14,17-trihydroxyheptadecyl]-2-methyl-2H-furan-5-one |
SMILES (Canonical) | CCCCCCC(CCCC(C1CCC(O1)C(CCC(C(CCCCCCCCCCCCC2=CC(OC2=O)C)O)O)O)O)O |
SMILES (Isomeric) | CCCCCCC(CCC[C@@H]([C@H]1CC[C@@H](O1)[C@@H](CC[C@H]([C@@H](CCCCCCCCCCCCC2=C[C@@H](OC2=O)C)O)O)O)O)O |
InChI | InChI=1S/C37H68O8/c1-3-4-5-15-19-30(38)20-17-22-33(41)35-25-26-36(45-35)34(42)24-23-32(40)31(39)21-16-13-11-9-7-6-8-10-12-14-18-29-27-28(2)44-37(29)43/h27-28,30-36,38-42H,3-26H2,1-2H3/t28-,30?,31+,32+,33-,34+,35+,36+/m0/s1 |
InChI Key | HCSSMEMSGLDFIN-GHTOWDLGSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C37H68O8 |
Molecular Weight | 640.90 g/mol |
Exact Mass | 640.49141912 g/mol |
Topological Polar Surface Area (TPSA) | 137.00 Ų |
XlogP | 8.50 |
CHEMBL448701 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.75% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.01% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.91% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.50% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.30% | 94.73% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.36% | 83.82% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.45% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.41% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.33% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.06% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.90% | 90.71% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.51% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.52% | 92.86% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.03% | 93.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.06% | 99.23% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 83.29% | 85.94% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.25% | 92.88% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.99% | 100.00% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.58% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona squamosa |
PubChem | 44577074 |
NPASS | NPC329838 |
ChEMBL | CHEMBL448701 |
LOTUS | LTS0201720 |
wikiData | Q105025952 |