Spruceanol
Internal ID | 90e4968c-8e37-4630-90f2-5fc2887e8595 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (2R,4aR,10aS)-8-ethenyl-1,1,4a,7-tetramethyl-2,3,4,9,10,10a-hexahydrophenanthrene-2,6-diol |
SMILES (Canonical) | CC1=C(C=C2C(=C1C=C)CCC3C2(CCC(C3(C)C)O)C)O |
SMILES (Isomeric) | CC1=C(C=C2C(=C1C=C)CC[C@H]3[C@]2(CC[C@H](C3(C)C)O)C)O |
InChI | InChI=1S/C20H28O2/c1-6-13-12(2)16(21)11-15-14(13)7-8-17-19(3,4)18(22)9-10-20(15,17)5/h6,11,17-18,21-22H,1,7-10H2,2-5H3/t17-,18-,20+/m1/s1 |
InChI Key | KNSRUHGNXCWGHF-GGPKGHCWSA-N |
Popularity | 7 references in papers |
Molecular Formula | C20H28O2 |
Molecular Weight | 300.40 g/mol |
Exact Mass | 300.208930132 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 5.20 |
72963-56-5 |
CHEBI:9244 |
(2R,4aR,10aS)-8-ethenyl-1,1,4a,7-tetramethyl-2,3,4,9,10,10a-hexahydrophenanthrene-2,6-diol |
NSC 312885 |
3alpha,12-Hydroxy-cleistanth-8,11,13,15-tetraene |
CHEMBL451294 |
NSC-312885 |
DTXSID30993734 |
(2R,4aR,10aS)-1,1,4a,7-tetramethyl-8-vinyl-2,3,4,9,10,10a-hexahydrophenanthrene-2,6-diol |
C09188 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.71% | 91.11% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.31% | 92.94% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.17% | 91.49% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.13% | 93.40% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.78% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 89.45% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.28% | 95.56% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 88.84% | 91.79% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.04% | 94.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.92% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.45% | 97.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.31% | 93.99% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.99% | 90.24% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.95% | 91.03% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.89% | 96.43% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.16% | 89.00% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.62% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Croton insularis |
Flueggea virosa |
Givotia madagascariensis |
Jatropha divaricata |
Micrandra spruceana |
Phyllanthus oxyphyllus |
PubChem | 155764 |
NPASS | NPC219112 |
ChEMBL | CHEMBL451294 |
LOTUS | LTS0186159 |
wikiData | Q27108333 |